Difference between revisions of "Tiso gene 11916"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-26 RXN1G-26] == * direction: ** LEFT-TO-RIGHT * common name: ** cis-delta5-3-oxo-C24:1-[acyl-...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12513 CPD-12513] == * smiles: ** C3(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-26 RXN1G-26] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12513 CPD-12513] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C3(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))C(O)C(O)C(O)3)
 +
* inchi key:
 +
** InChIKey=DQQDLYVHOTZLOR-IAZOVDBXSA-L
 
* common name:
 
* common name:
−
** cis-delta5-3-oxo-C24:1-[acyl-carrier protein] synthase
+
** UDP-β-L-arabinopyranose
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.3.1.M1 EC-2.3.1.M1]
+
** 534.263   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[MALONYL-ACP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[cis-delta3-behenoyl-ACPs]][c] '''=>''' 1 [[cis-delta5-3-oxo-lignoceroyl-ACPs]][c] '''+''' 1 [[ACP]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[UDP-ARABINOSE-4-EPIMERASE-RXN]]
−
** 1 a malonyl-[acp][c] '''+''' 1 H+[c] '''+''' 1 a cis-docos-3-enoyl-[acp][c] '''=>''' 1 a cis-delta5-3-oxo-C24:1-[acp][c] '''+''' 1 a holo-[acyl-carrier protein][c] '''+''' 1 CO2[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_14485]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_19302]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_15991]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
+
−
** '''86''' reactions found over '''182''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=cis-delta5-3-oxo-C24:1-[acyl-carrier protein] synthase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246220 25246220]
−
{{#set: ec number=EC-2.3.1.M1}}
+
* CHEBI:
−
{{#set: gene associated=Tiso_gene_14485|Tiso_gene_19302|Tiso_gene_15991}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61457 61457]
−
{{#set: in pathway=PWYG-321}}
+
{{#set: smiles=C3(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))C(O)C(O)C(O)3)}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: inchi key=InChIKey=DQQDLYVHOTZLOR-IAZOVDBXSA-L}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: common name=UDP-β-L-arabinopyranose}}
−
{{#set: reconstruction source=esiliculosus}}
+
{{#set: molecular weight=534.263    }}
 +
{{#set: reversible reaction associated=UDP-ARABINOSE-4-EPIMERASE-RXN}}

Revision as of 18:14, 18 March 2018

Metabolite CPD-12513

  • smiles:
    • C3(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))C(O)C(O)C(O)3)
  • inchi key:
    • InChIKey=DQQDLYVHOTZLOR-IAZOVDBXSA-L
  • common name:
    • UDP-β-L-arabinopyranose
  • molecular weight:
    • 534.263
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C3(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))C(O)C(O)C(O)3)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_11916&oldid=22870"