Difference between revisions of "PWY-5033"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7006 CPD-7006] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14500 RXN-14500] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula == * With ide...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7006 CPD-7006] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14500 RXN-14500] ==
−
* smiles:
+
* direction:
−
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=NVDIDZKEPDPXJJ-ONWAGYJKSA-M
+
−
* common name:
+
−
** tetrahydrogeranylgeranyl chlorophyll a
+
−
* molecular weight:
+
−
** 890.479   
+
 
* Synonym(s):
 
* Synonym(s):
−
** tetrahydroGG-chlorophyll a
 
−
** tetrahydroGG-chl a
 
−
** tetrahydrogeranylgeranyl-chl a
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-7666]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-15373]][c] '''<=>''' 1 [[D-mannopyranose]][c]
−
* [[RXN-7665]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 aldehydo-D-mannose[c] '''<=>''' 1 D-mannopyranose[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-3861]], mannitol degradation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3861 PWY-3861]
 +
** '''3''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46926313 46926313]
+
{{#set: in pathway=PWY-3861}}
−
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: inchi key=InChIKey=NVDIDZKEPDPXJJ-ONWAGYJKSA-M}}
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
−
{{#set: common name=tetrahydrogeranylgeranyl chlorophyll a}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: molecular weight=890.479    }}
+
−
{{#set: common name=tetrahydroGG-chlorophyll a|tetrahydroGG-chl a|tetrahydrogeranylgeranyl-chl a}}
+
−
{{#set: consumed by=RXN-7666}}
+
−
{{#set: produced by=RXN-7665}}
+

Revision as of 18:14, 18 March 2018

Reaction RXN-14500

  • direction:
    • REVERSIBLE
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 aldehydo-D-mannose[c] <=> 1 D-mannopyranose[c]

Genes associated with this reaction

Pathways

  • PWY-3861, mannitol degradation II: PWY-3861
    • 3 reactions found over 4 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-5033&oldid=22934"