Difference between revisions of "RXN-11057"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PORPHOBILINOGEN PORPHOBILINOGEN] == * smiles: ** C(C1(=C(C(=CN1)CCC(=O)[O-])CC(=O)[O-]))[N+] *...") |
(Created page with "Category:Gene == Gene Tiso_gene_11913 == * left end position: ** 6005 * transcription direction: ** POSITIVE * right end position: ** 7187 * centisome position: ** 80.8754...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_11913 == |
− | * | + | * left end position: |
− | ** | + | ** 6005 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 7187 |
− | * | + | * centisome position: |
− | ** | + | ** 80.87542 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[RXN-11839]] |
− | + | ** in-silico_annotation | |
− | * [[ | + | ***automated-name-match |
− | == | + | * [[RXN-11840]] |
+ | ** in-silico_annotation | ||
+ | ***automated-name-match | ||
+ | * [[RXN-11841]] | ||
+ | ** in-silico_annotation | ||
+ | ***automated-name-match | ||
+ | * [[RXN-11842]] | ||
+ | ** in-silico_annotation | ||
+ | ***automated-name-match | ||
+ | * [[TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN]] | ||
+ | ** in-silico_annotation | ||
+ | ***automated-name-match | ||
+ | ** experimental_annotation | ||
+ | ***automated-name-match | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=6005}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=7187}} | |
− | + | {{#set: centisome position=80.87542 }} | |
− | + | {{#set: reaction associated=RXN-11839|RXN-11840|RXN-11841|RXN-11842|TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 18:15, 18 March 2018
Gene Tiso_gene_11913
- left end position:
- 6005
- transcription direction:
- POSITIVE
- right end position:
- 7187
- centisome position:
- 80.87542
- Synonym(s):
Reactions associated
- RXN-11839
- in-silico_annotation
- automated-name-match
- in-silico_annotation
- RXN-11840
- in-silico_annotation
- automated-name-match
- in-silico_annotation
- RXN-11841
- in-silico_annotation
- automated-name-match
- in-silico_annotation
- RXN-11842
- in-silico_annotation
- automated-name-match
- in-silico_annotation
- TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN
- in-silico_annotation
- automated-name-match
- experimental_annotation
- automated-name-match
- pantograph-esiliculosus
- in-silico_annotation