Difference between revisions of "Tiso gene 873"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-706 CPD-706] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC...")
(Created page with "Category:Gene == Gene Tiso_gene_16935 == * left end position: ** 37 * transcription direction: ** POSITIVE * right end position: ** 1881 * centisome position: ** 0.918342...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-706 CPD-706] ==
+
== Gene Tiso_gene_16935 ==
* smiles:
+
* left end position:
** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** 37
* inchi key:
+
* transcription direction:
** InChIKey=INDVLXYUCBVVKW-PXBBAZSNSA-N
+
** POSITIVE
* common name:
+
* right end position:
** 24-methylenecholesterol
+
** 1881
* molecular weight:
+
* centisome position:
** 398.671    
+
** 0.918342    
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* [[2.1.1.77-RXN]]
* [[RXN-707]]
+
** in-silico_annotation
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=37}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=92113 92113]
+
{{#set: transcription direction=POSITIVE}}
* LIGAND-CPD:
+
{{#set: right end position=1881}}
** [http://www.genome.jp/dbget-bin/www_bget?C15781 C15781]
+
{{#set: centisome position=0.918342   }}
* HMDB : HMDB06849
+
{{#set: reaction associated=2.1.1.77-RXN}}
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: inchi key=InChIKey=INDVLXYUCBVVKW-PXBBAZSNSA-N}}
+
{{#set: common name=24-methylenecholesterol}}
+
{{#set: molecular weight=398.671   }}
+
{{#set: produced by=RXN-707}}
+

Revision as of 19:16, 18 March 2018

Gene Tiso_gene_16935

  • left end position:
    • 37
  • transcription direction:
    • POSITIVE
  • right end position:
    • 1881
  • centisome position:
    • 0.918342
  • Synonym(s):

Reactions associated

Pathways associated

External links