Difference between revisions of "Cerebrosides"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-712 CPD-712] == * smiles: ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]...")
(Created page with "Category:Gene == Gene Tiso_gene_19883 == * left end position: ** 61 * transcription direction: ** POSITIVE * right end position: ** 1172 * centisome position: ** 3.12981...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-712 CPD-712] ==
+
== Gene Tiso_gene_19883 ==
−
* smiles:
+
* left end position:
−
** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** 61
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ZHZKWZJLUNXOSN-YUZBOUAZSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 6-deoxocathasterone
+
** 1172
−
* molecular weight:
+
* centisome position:
−
** 418.702    
+
** 3.12981    
 
* Synonym(s):
 
* Synonym(s):
−
** deoxocathasterone
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-774]]
+
* [[HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** in-silico_annotation
−
* [[RXN-773]]
+
***ec-number
−
== Reaction(s) of unknown directionality ==
+
** [[pantograph]]-[[esiliculosus]]
 +
* [[RXN-11201]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMST01030124
+
{{#set: left end position=61}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16061344 16061344]
+
{{#set: right end position=1172}}
−
* CHEBI:
+
{{#set: centisome position=3.12981   }}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20714 20714]
+
{{#set: reaction associated=HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN|RXN-11201}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C15798 C15798]
+
−
{{#set: smiles=CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
−
{{#set: inchi key=InChIKey=ZHZKWZJLUNXOSN-YUZBOUAZSA-N}}
+
−
{{#set: common name=6-deoxocathasterone}}
+
−
{{#set: molecular weight=418.702   }}
+
−
{{#set: common name=deoxocathasterone}}
+
−
{{#set: consumed by=RXN-774}}
+
−
{{#set: produced by=RXN-773}}
+

Revision as of 18:17, 18 March 2018

Gene Tiso_gene_19883

  • left end position:
    • 61
  • transcription direction:
    • POSITIVE
  • right end position:
    • 1172
  • centisome position:
    • 3.12981
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Cerebrosides&oldid=23185"