Difference between revisions of "2PGADEHYDRAT-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORIBOSYL-ATP PHOSPHORIBOSYL-ATP] == * smiles: ** C(C4(C(C(C(N3(C(C2(=C(N(C1(C(C(C(O1)COP(...")
(Created page with "Category:Gene == Gene Tiso_gene_11832 == * left end position: ** 5332 * transcription direction: ** POSITIVE * right end position: ** 7447 * centisome position: ** 71.2262...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORIBOSYL-ATP PHOSPHORIBOSYL-ATP] ==
+
== Gene Tiso_gene_11832 ==
−
* smiles:
+
* left end position:
−
** C(C4(C(C(C(N3(C(C2(=C(N(C1(C(C(C(O1)COP(OP(=O)([O-])OP(=O)([O-])O)(=O)[O-])O)O))C=N2)N=C3))=N))O4)O)O))OP([O-])([O-])=O
+
** 5332
−
* inchi key:
+
* transcription direction:
−
** InChIKey=RKNHJBVBFHDXGR-KEOHHSTQSA-I
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 1-(5-phospho-β-D-ribosyl)-ATP
+
** 7447
−
* molecular weight:
+
* centisome position:
−
** 714.24    
+
** 71.22629    
 
* Synonym(s):
 
* Synonym(s):
−
** 1-(5-phosphoribosyl)-ATP
 
−
** N1-(5-phospho-D-ribosyl)-ATP
 
−
** 5-phosphoribosyl-ATP
 
−
** 1-(5-phospho-D-ribosyl)-ATP
 
−
** phosphoribosyl-ATP
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[HISTPRATPHYD-RXN]]
+
* [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
−
* [[PRADP]]
+
** in-silico_annotation
−
== Reaction(s) known to produce the compound ==
+
***ec-number
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
−
* [[ATPPHOSPHORIBOSYLTRANS-RXN]]
+
 
== External links  ==
 
== External links  ==
−
* DRUGBANK : DB01661
+
{{#set: left end position=5332}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658853 90658853]
+
{{#set: right end position=7447}}
−
* HMDB : HMDB03665
+
{{#set: centisome position=71.22629   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02739 C02739]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73200 73200]
+
−
* BIGG : prbatp
+
−
{{#set: smiles=C(C4(C(C(C(N3(C(C2(=C(N(C1(C(C(C(O1)COP(OP(=O)([O-])OP(=O)([O-])O)(=O)[O-])O)O))C=N2)N=C3))=N))O4)O)O))OP([O-])([O-])=O}}
+
−
{{#set: inchi key=InChIKey=RKNHJBVBFHDXGR-KEOHHSTQSA-I}}
+
−
{{#set: common name=1-(5-phospho-β-D-ribosyl)-ATP}}
+
−
{{#set: molecular weight=714.24   }}
+
−
{{#set: common name=1-(5-phosphoribosyl)-ATP|N1-(5-phospho-D-ribosyl)-ATP|5-phosphoribosyl-ATP|1-(5-phospho-D-ribosyl)-ATP|phosphoribosyl-ATP}}
+
−
{{#set: consumed by=HISTPRATPHYD-RXN|PRADP}}
+
−
{{#set: consumed or produced by=ATPPHOSPHORIBOSYLTRANS-RXN}}
+

Revision as of 18:17, 18 March 2018

Gene Tiso_gene_11832

  • left end position:
    • 5332
  • transcription direction:
    • POSITIVE
  • right end position:
    • 7447
  • centisome position:
    • 71.22629
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=2PGADEHYDRAT-RXN&oldid=23189"