Difference between revisions of "RXN-13301"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_13244 == * Synonym(s): == Reactions associated == * PROTEIN-KINASE-RXN ** pantograph-esiliculosus == Pathways associated == ==...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12310 CPD-12310] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(C)=CC...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12310 CPD-12310] == |
| + | * smiles: | ||
| + | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCOP(=O)([O-])OP(=O)([O-])OC4(OC(CO)C(OC3(OC(CO)C(OC2(OC(CO)C(OC1(OC(CO)C(O)C(O)C(NC(=O)C)1))C(OC(C)C(=O)NC(C)C(=O)NC(CCC(=O)NC(CCCCNC(CC([N+])C(N)=O)=O)C(NC(C)C(NC(C([O-])=O)C)=O)=O)C(=O)N)C(NC(C)=O)2))C(O)C(NC(=O)C)3))C(OC(C)C(=O)NC(C)C(=O)NC(CCC(=O)NC(CCCCNC(CC([N+])C(N)=O)=O)C(NC(C)C(NC(C([O-])=O)C)=O)=O)C(=O)N)C(NC(C)=O)4))C)C)C)C)C)C | ||
| + | * inchi key: | ||
| + | ** InChIKey=MCSKGNVEEFRWNJ-QCZQNIDJSA-L | ||
| + | * common name: | ||
| + | ** a peptidoglycan dimer (E. faeciums) | ||
| + | * molecular weight: | ||
| + | ** 3049.45 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** [N-acetylglucosamine-N-acetylmuramoyl-L-alanyl-D-glutamyl-L-lysyl-(Gly5)-D-alanyl-D-alanine]2 diphospho-undecaprenyl | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-11351]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173179 46173179] | ||
| + | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCOP(=O)([O-])OP(=O)([O-])OC4(OC(CO)C(OC3(OC(CO)C(OC2(OC(CO)C(OC1(OC(CO)C(O)C(O)C(NC(=O)C)1))C(OC(C)C(=O)NC(C)C(=O)NC(CCC(=O)NC(CCCCNC(CC([N+])C(N)=O)=O)C(NC(C)C(NC(C([O-])=O)C)=O)=O)C(=O)N)C(NC(C)=O)2))C(O)C(NC(=O)C)3))C(OC(C)C(=O)NC(C)C(=O)NC(CCC(=O)NC(CCCCNC(CC([N+])C(N)=O)=O)C(NC(C)C(NC(C([O-])=O)C)=O)=O)C(=O)N)C(NC(C)=O)4))C)C)C)C)C)C}} | ||
| + | {{#set: inchi key=InChIKey=MCSKGNVEEFRWNJ-QCZQNIDJSA-L}} | ||
| + | {{#set: common name=a peptidoglycan dimer (E. faeciums)}} | ||
| + | {{#set: molecular weight=3049.45 }} | ||
| + | {{#set: common name=[N-acetylglucosamine-N-acetylmuramoyl-L-alanyl-D-glutamyl-L-lysyl-(Gly5)-D-alanyl-D-alanine]2 diphospho-undecaprenyl}} | ||
| + | {{#set: consumed by=RXN-11351}} | ||
Revision as of 18:17, 18 March 2018
Contents
Metabolite CPD-12310
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCOP(=O)([O-])OP(=O)([O-])OC4(OC(CO)C(OC3(OC(CO)C(OC2(OC(CO)C(OC1(OC(CO)C(O)C(O)C(NC(=O)C)1))C(OC(C)C(=O)NC(C)C(=O)NC(CCC(=O)NC(CCCCNC(CC([N+])C(N)=O)=O)C(NC(C)C(NC(C([O-])=O)C)=O)=O)C(=O)N)C(NC(C)=O)2))C(O)C(NC(=O)C)3))C(OC(C)C(=O)NC(C)C(=O)NC(CCC(=O)NC(CCCCNC(CC([N+])C(N)=O)=O)C(NC(C)C(NC(C([O-])=O)C)=O)=O)C(=O)N)C(NC(C)=O)4))C)C)C)C)C)C
- inchi key:
- InChIKey=MCSKGNVEEFRWNJ-QCZQNIDJSA-L
- common name:
- a peptidoglycan dimer (E. faeciums)
- molecular weight:
- 3049.45
- Synonym(s):
- [N-acetylglucosamine-N-acetylmuramoyl-L-alanyl-D-glutamyl-L-lysyl-(Gly5)-D-alanyl-D-alanine]2 diphospho-undecaprenyl
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCOP(=O)([O-])OP(=O)([O-])OC4(OC(CO)C(OC3(OC(CO)C(OC2(OC(CO)C(OC1(OC(CO)C(O)C(O)C(NC(=O)C)1))C(OC(C)C(=O)NC(C)C(=O)NC(CCC(=O)NC(CCCCNC(CC([N+])C(N)=O)=O)C(NC(C)C(NC(C([O-])=O)C)=O)=O)C(=O)N)C(NC(C)=O)2))C(O)C(NC(=O)C)3))C(OC(C)C(=O)NC(C)C(=O)NC(CCC(=O)NC(CCCCNC(CC([N+])C(N)=O)=O)C(NC(C)C(NC(C([O-])=O)C)=O)=O)C(=O)N)C(NC(C)=O)4))C)C)C)C)C)C" cannot be used as a page name in this wiki.
"N-acetylglucosamine-N-acetylmuramoyl-L-alanyl-D-glutamyl-L-lysyl-(Gly5)-D-alanyl-D-alanine]2 diphospho-undecaprenyl" cannot be used as a page name in this wiki.
