Difference between revisions of "Hexanoyl-ACPs"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-150 RXN1F-150] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TROPINONE TROPINONE] == * smiles: ** C[N+]1(C2(CCC1CC(=O)C2)) * inchi key: ** InChIKey=QQXLDOJG...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TROPINONE TROPINONE] == |
| − | * | + | * smiles: |
| − | ** | + | ** C[N+]1(C2(CCC1CC(=O)C2)) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=QQXLDOJGLXJCSE-KNVOCYPGSA-O |
| + | * common name: | ||
| + | ** tropinone | ||
| + | * molecular weight: | ||
| + | ** 140.205 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[TROPINE-DEHYDROGENASE-RXN]] | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * NCI: |
| − | ** [http:// | + | ** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=118012 118012] |
| − | * LIGAND- | + | * CAS : 532-24-1 |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * PUBCHEM: |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=698003 698003] | |
| − | + | * LIGAND-CPD: | |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00783 C00783] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.2789160.html 2789160] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57851 57851] |
| + | {{#set: smiles=C[N+]1(C2(CCC1CC(=O)C2))}} | ||
| + | {{#set: inchi key=InChIKey=QQXLDOJGLXJCSE-KNVOCYPGSA-O}} | ||
| + | {{#set: common name=tropinone}} | ||
| + | {{#set: molecular weight=140.205 }} | ||
| + | {{#set: reversible reaction associated=TROPINE-DEHYDROGENASE-RXN}} | ||
Revision as of 18:18, 18 March 2018
Contents
Metabolite TROPINONE
- smiles:
- C[N+]1(C2(CCC1CC(=O)C2))
- inchi key:
- InChIKey=QQXLDOJGLXJCSE-KNVOCYPGSA-O
- common name:
- tropinone
- molecular weight:
- 140.205
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C[N+]1(C2(CCC1CC(=O)C2))" cannot be used as a page name in this wiki.
