Difference between revisions of "CHLOROPHYLL-SYN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-delta7-3-oxo-cerotoyl-ACPs cis-delta7-3-oxo-cerotoyl-ACPs] == * common name: ** a cis-delta...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ENT-KAUR-16-EN-19-AL ENT-KAUR-16-EN-19-AL] == * smiles: ** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C=O)CCC...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ENT-KAUR-16-EN-19-AL ENT-KAUR-16-EN-19-AL] == |
| + | * smiles: | ||
| + | ** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C=O)CCCC(C)2[CH]3CC4)))) | ||
| + | * inchi key: | ||
| + | ** InChIKey=JCAVDWHQNFTFBW-XRNRSJMDSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** ent-kaurenal |
| + | * molecular weight: | ||
| + | ** 286.456 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** ent-kaur-16-en-19-al | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-7580]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-5242]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: consumed by= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=443466 443466] |
| − | {{#set: produced by= | + | * CHEMSPIDER: |
| + | ** [http://www.chemspider.com/Chemical-Structure.391680.html 391680] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29609 29609] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C11873 C11873] | ||
| + | * HMDB : HMDB36728 | ||
| + | {{#set: smiles=C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C=O)CCCC(C)2[CH]3CC4))))}} | ||
| + | {{#set: inchi key=InChIKey=JCAVDWHQNFTFBW-XRNRSJMDSA-N}} | ||
| + | {{#set: common name=ent-kaurenal}} | ||
| + | {{#set: molecular weight=286.456 }} | ||
| + | {{#set: common name=ent-kaur-16-en-19-al}} | ||
| + | {{#set: consumed by=RXN-7580}} | ||
| + | {{#set: produced by=RXN-5242}} | ||
Revision as of 18:18, 18 March 2018
Contents
Metabolite ENT-KAUR-16-EN-19-AL
- smiles:
- C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C=O)CCCC(C)2[CH]3CC4))))
- inchi key:
- InChIKey=JCAVDWHQNFTFBW-XRNRSJMDSA-N
- common name:
- ent-kaurenal
- molecular weight:
- 286.456
- Synonym(s):
- ent-kaur-16-en-19-al
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C=O)CCCC(C)2[CH]3CC4))))" cannot be used as a page name in this wiki.
