Difference between revisions of "PWY-7085"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12904 CPD-12904] == * smiles: ** CC(C)=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6642 RXN-6642] == * direction: ** LEFT-TO-RIGHT * common name: ** aminopeptidase_n ** membrane_...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12904 CPD-12904] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6642 RXN-6642] ==
−
* smiles:
+
* direction:
−
** CC(C)=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=IFMYVRQEHQTINS-MEOYLLPMSA-J
+
 
* common name:
 
* common name:
−
** (2E)-5-methylhexa-2,4-dienoyl-CoA
+
** aminopeptidase_n
−
* molecular weight:
+
** membrane_aminopeptidase_i
−
** 871.642   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/3.4.11.2 EC-3.4.11.2]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-11919]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[WATER]][c] '''+''' 1 [[CPD-6262]][c] '''=>''' 1 [[GLY]][c] '''+''' 1 [[S-Substituted-L-Cysteines]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 H2O[c] '''+''' 1 a [Cys-Gly]-S-conjugate[c] '''=>''' 1 glycine[c] '''+''' 1 an L-cysteine-S-conjugate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_860]]
 +
** IN-SILICO_ANNOTATION
 +
***AUTOMATED-NAME-MATCH
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[Tiso_gene_16906]]
 +
** IN-SILICO_ANNOTATION
 +
***AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-6842]], glutathione-mediated detoxification II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6842 PWY-6842]
 +
** '''2''' reactions found over '''8''' reactions in the full pathway
 +
* [[PWY-4061]], glutathione-mediated detoxification I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-4061 PWY-4061]
 +
** '''2''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986176 50986176]
+
{{#set: common name=aminopeptidase_n}}
−
* LIGAND-CPD:
+
{{#set: common name=membrane_aminopeptidase_i}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16468 C16468]
+
{{#set: ec number=EC-3.4.11.2}}
−
{{#set: smiles=CC(C)=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: gene associated=Tiso_gene_860|Tiso_gene_16906}}
−
{{#set: inchi key=InChIKey=IFMYVRQEHQTINS-MEOYLLPMSA-J}}
+
{{#set: in pathway=PWY-6842|PWY-4061}}
−
{{#set: common name=(2E)-5-methylhexa-2,4-dienoyl-CoA}}
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: molecular weight=871.642    }}
+
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}}
−
{{#set: consumed by=RXN-11919}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}

Revision as of 18:19, 18 March 2018

Reaction RXN-6642

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • aminopeptidase_n
    • membrane_aminopeptidase_i
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6842, glutathione-mediated detoxification II: PWY-6842
    • 2 reactions found over 8 reactions in the full pathway
  • PWY-4061, glutathione-mediated detoxification I: PWY-4061
    • 2 reactions found over 5 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-7085&oldid=23439"