Difference between revisions of "Tiso gene 4026"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=44-DIMETHYL-CHOLESTA-812-24-TRIENOL 44-DIMETHYL-CHOLESTA-812-24-TRIENOL] == * smiles: ** CC(C)=...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11574 RXN-11574] == * direction: ** LEFT-TO-RIGHT * common name: ** rna_methylase * ec number:...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=44-DIMETHYL-CHOLESTA-812-24-TRIENOL 44-DIMETHYL-CHOLESTA-812-24-TRIENOL] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11574 RXN-11574] ==
* smiles:
+
* direction:
** CC(C)=CCCC([CH]1(C2(C)(C(=CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=LFQXEZVYNCBVDO-PBJLWWPKSA-N
+
 
* common name:
 
* common name:
** 4,4-dimethyl-cholesta-8,12,24-trienol
+
** rna_methylase
* molecular weight:
+
* ec number:
** 410.682   
+
** [http://enzyme.expasy.org/EC/2.1.1.173 EC-2.1.1.173]
 
* Synonym(s):
 
* Synonym(s):
** 17-(1,5-dimethylhex-4-enyl)-4,4,10,13-tetramethyl-2,3,4,5,6,7, 10,11,12,13,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol
 
** 4,4-dimethyl-5α-cholesta-8,14,24-trien-3β-ol
 
** 4,4-dimethyl-5-α-cholesta-8,14,24-trien-3-β-ol
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN66-306]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[S-ADENOSYLMETHIONINE]][c] '''+''' 1 [[23S-rRNA-guanine-2445]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[23S-RRNA-N2-METHYLGUANINE2445]][c]
* [[RXN3O-130]]
+
* With common name(s):
* [[RXN66-305]]
+
** 1 S-adenosyl-L-methionine[c] '''+''' 1 a guanine2445 in 23S rRNA[c] '''=>''' 1 H+[c] '''+''' 1 S-adenosyl-L-homocysteine[c] '''+''' 1 an N2-methylguanine2445 in 23S rRNA[c]
== Reaction(s) of unknown directionality ==
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_15181]]
 +
** IN-SILICO_ANNOTATION
 +
***EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=443212 443212]
+
{{#set: common name=rna_methylase}}
* CHEBI:
+
{{#set: ec number=EC-2.1.1.173}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17813 17813]
+
{{#set: gene associated=Tiso_gene_15181}}
* LIGAND-CPD:
+
{{#set: in pathway=}}
** [http://www.genome.jp/dbget-bin/www_bget?C11455 C11455]
+
{{#set: reconstruction category=annotation}}
* HMDB : HMDB01023
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
{{#set: smiles=CC(C)=CCCC([CH]1(C2(C)(C(=CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C}}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: inchi key=InChIKey=LFQXEZVYNCBVDO-PBJLWWPKSA-N}}
+
{{#set: common name=4,4-dimethyl-cholesta-8,12,24-trienol}}
+
{{#set: molecular weight=410.682    }}
+
{{#set: common name=17-(1,5-dimethylhex-4-enyl)-4,4,10,13-tetramethyl-2,3,4,5,6,7, 10,11,12,13,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol|4,4-dimethyl-5α-cholesta-8,14,24-trien-3β-ol|4,4-dimethyl-5-α-cholesta-8,14,24-trien-3-β-ol}}
+
{{#set: consumed by=RXN66-306}}
+
{{#set: produced by=RXN3O-130|RXN66-305}}
+

Revision as of 18:19, 18 March 2018

Reaction RXN-11574

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • rna_methylase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links