Difference between revisions of "ETHYL-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LL-DIAMINOPIMELATE LL-DIAMINOPIMELATE] == * smiles: ** C(C(CCCC(C([O-])=O)[N+])[N+])([O-])=O *...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6876 PWY-6876] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6876 PWY-6876] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** isopropanol biosynthesis (engineered) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''2''' reactions found over '''5''' reactions in the full pathway | |
− | == Reaction(s) | + | * [[ACETOACETATE-DECARBOXYLASE-RXN]] |
− | * [ | + | ** 0 associated gene: |
− | * [ | + | ** 2 reconstruction source(s) associated: |
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | * [[ACETYL-COA-ACETYLTRANSFER-RXN]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[Tiso_gene_16181]] | ||
+ | *** [[Tiso_gene_15327]] | ||
+ | *** [[Tiso_gene_17451]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | *** [[orthology-synechocystis]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=ACETOACETYL-COA-HYDROLASE-RXN ACETOACETYL-COA-HYDROLASE-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=ISOPROPANOL-DEHYDROGENASE-NADP+-RXN ISOPROPANOL-DEHYDROGENASE-NADP+-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=PYRUFLAVREDUCT-RXN PYRUFLAVREDUCT-RXN] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=isopropanol biosynthesis (engineered)}} | |
− | + | {{#set: reaction found=2}} | |
− | + | {{#set: total reaction=5}} | |
− | + | {{#set: completion rate=40.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 19:19, 18 March 2018
Pathway PWY-6876
- taxonomic range:
- common name:
- isopropanol biosynthesis (engineered)
- Synonym(s):
Reaction(s) found
2 reactions found over 5 reactions in the full pathway
- ACETOACETATE-DECARBOXYLASE-RXN
- 0 associated gene:
- 2 reconstruction source(s) associated:
- ACETYL-COA-ACETYLTRANSFER-RXN
- 3 associated gene(s):
- 4 reconstruction source(s) associated: