Difference between revisions of "PLASMENYLCHOLINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1718 CPD0-1718] == * smiles: ** C1(=NC2(=C(NC1)N=C(N)NC(=O)2)) * inchi key: ** InChIKey=PX...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7800 RXN-7800] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With id...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7800 RXN-7800] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | = | + | ** 1 [[PROTON]][c] '''+''' 1 [[CPD-7100]][c] '''=>''' 1 [[2K-4CH3-PENTANOATE]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 H+[c] '''+''' 1 (2S)-2-isopropyl-3-oxosuccinate[c] '''=>''' 1 4-methyl-2-oxopentanoate[c] '''+''' 1 CO2[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | == Pathways == | ||
| + | * [[LEUSYN-PWY]], L-leucine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=LEUSYN-PWY LEUSYN-PWY] | ||
| + | ** '''6''' reactions found over '''6''' reactions in the full pathway | ||
| + | * [[PWY-6871]], 3-methylbutanol biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6871 PWY-6871] | ||
| + | ** '''6''' reactions found over '''7''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-experimental_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | * | + | * RHEA: |
| − | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=25078 25078] |
| − | * | + | * LIGAND-RXN: |
| − | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01652 R01652] |
| − | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
| − | + | {{#set: in pathway=LEUSYN-PWY|PWY-6871}} | |
| − | {{#set: | + | {{#set: reconstruction category=annotation}} |
| − | {{#set: | + | {{#set: reconstruction source=annotation-experimental_annotation}} |
| − | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
| − | {{#set: | + | |
Revision as of 18:19, 18 March 2018
Contents
Reaction RXN-7800
- direction:
- LEFT-TO-RIGHT
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 PROTON[c] + 1 CPD-7100[c] => 1 2K-4CH3-PENTANOATE[c] + 1 CARBON-DIOXIDE[c]
- With common name(s):
- 1 H+[c] + 1 (2S)-2-isopropyl-3-oxosuccinate[c] => 1 4-methyl-2-oxopentanoate[c] + 1 CO2[c]
Genes associated with this reaction
Pathways
- LEUSYN-PWY, L-leucine biosynthesis: LEUSYN-PWY
- 6 reactions found over 6 reactions in the full pathway
- PWY-6871, 3-methylbutanol biosynthesis (engineered): PWY-6871
- 6 reactions found over 7 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
External links
