Difference between revisions of "GLUGLNSYN-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYXYLULOSE-5P DEOXYXYLULOSE-5P] == * smiles: ** CC(=O)C(O)C(O)COP([O-])(=O)[O-] * inchi key:...") |
(Created page with "Category:Gene == Gene Tiso_gene_1790 == * Synonym(s): == Reactions associated == * 3.6.3.50-RXN ** pantograph-esiliculosus * ATPASE-RXN ** pantograph-...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_1790 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reactions associated == |
| − | + | * [[3.6.3.50-RXN]] | |
| − | * [[ | + | ** [[pantograph]]-[[esiliculosus]] |
| − | + | * [[ATPASE-RXN]] | |
| − | * [[ | + | ** [[pantograph]]-[[athaliana]] |
| + | == Pathways associated == | ||
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=3.6.3.50-RXN|ATPASE-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
Revision as of 18:21, 18 March 2018
Gene Tiso_gene_1790
- Synonym(s):
