Difference between revisions of "Tiso gene 1943"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=P101-PWY P101-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14601 CPD-14601] == * smiles: ** CC(CCC([O-])=O)=CCC1(=C(C(C)=C2(COC(=O)C(=C(O)1)2))OC) * i...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14601 CPD-14601] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** CC(CCC([O-])=O)=CCC1(=C(C(C)=C2(COC(=O)C(=C(O)1)2))OC) |
| + | * inchi key: | ||
| + | ** InChIKey=HPNSFSBZBAHARI-RUDMXATFSA-M | ||
* common name: | * common name: | ||
| − | ** | + | ** mycophenolate |
| + | * molecular weight: | ||
| + | ** 319.333 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** mycophenolic acid | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-13608]] | |
| − | + | * [[RXN-13607]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == Reaction(s) | + | == Reaction(s) of unknown directionality == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6918995 6918995] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62932 62932] |
| + | {{#set: smiles=CC(CCC([O-])=O)=CCC1(=C(C(C)=C2(COC(=O)C(=C(O)1)2))OC)}} | ||
| + | {{#set: inchi key=InChIKey=HPNSFSBZBAHARI-RUDMXATFSA-M}} | ||
| + | {{#set: common name=mycophenolate}} | ||
| + | {{#set: molecular weight=319.333 }} | ||
| + | {{#set: common name=mycophenolic acid}} | ||
| + | {{#set: consumed by=RXN-13608|RXN-13607}} | ||
Revision as of 15:53, 10 January 2018
Contents
Metabolite CPD-14601
- smiles:
- CC(CCC([O-])=O)=CCC1(=C(C(C)=C2(COC(=O)C(=C(O)1)2))OC)
- inchi key:
- InChIKey=HPNSFSBZBAHARI-RUDMXATFSA-M
- common name:
- mycophenolate
- molecular weight:
- 319.333
- Synonym(s):
- mycophenolic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(CCC([O-])=O)=CCC1(=C(C(C)=C2(COC(=O)C(=C(O)1)2))OC)" cannot be used as a page name in this wiki.
