Difference between revisions of "RXN-16425"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8355 CPD-8355] == * smiles: ** CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O * inchi ke...")
(Created page with "Category:Gene == Gene Tiso_gene_4659 == * left end position: ** 10639 * transcription direction: ** POSITIVE * right end position: ** 11632 * centisome position: ** 72.844...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8355 CPD-8355] ==
+
== Gene Tiso_gene_4659 ==
* smiles:
+
* left end position:
** CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O
+
** 10639
* inchi key:
+
* transcription direction:
** InChIKey=PYVRVRFVLRNJLY-MZMPXXGTSA-N
+
** POSITIVE
* common name:
+
* right end position:
** 1-18:1-2-lysophosphatidylethanolamine
+
** 11632
* molecular weight:
+
* centisome position:
** 479.593    
+
** 72.84492    
 
* Synonym(s):
 
* Synonym(s):
** 1-18:1-lysoPE
 
** 1-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-15035]]
+
* [[UDPNACETYLMURAMATEDEHYDROG-RXN]]
== Reaction(s) known to produce the compound ==
+
** in-silico_annotation
* [[RXN-15067]]
+
***ec-number
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
* [[RXN-15036]]
+
* [[PWY-6386]]
 +
* [[PWY-6387]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=10639}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=58177709 58177709]
+
{{#set: transcription direction=POSITIVE}}
* CHEBI:
+
{{#set: right end position=11632}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74971 74971]
+
{{#set: centisome position=72.84492   }}
* HMDB : HMDB11506
+
{{#set: reaction associated=UDPNACETYLMURAMATEDEHYDROG-RXN}}
{{#set: smiles=CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O}}
+
{{#set: pathway associated=PWY-6386|PWY-6387}}
{{#set: inchi key=InChIKey=PYVRVRFVLRNJLY-MZMPXXGTSA-N}}
+
{{#set: common name=1-18:1-2-lysophosphatidylethanolamine}}
+
{{#set: molecular weight=479.593   }}
+
{{#set: common name=1-18:1-lysoPE|1-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine}}
+
{{#set: consumed by=RXN-15035}}
+
{{#set: produced by=RXN-15067}}
+
{{#set: consumed or produced by=RXN-15036}}
+

Revision as of 18:21, 18 March 2018

Gene Tiso_gene_4659

  • left end position:
    • 10639
  • transcription direction:
    • POSITIVE
  • right end position:
    • 11632
  • centisome position:
    • 72.84492
  • Synonym(s):

Reactions associated

Pathways associated

External links