Difference between revisions of "K+"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-GUANIDO-BUTYRAMIDE 4-GUANIDO-BUTYRAMIDE] == * smiles: ** C(NC(N)=[N+])CCC(=O)N * inchi key: *...")
(Created page with "Category:Gene == Gene Tiso_gene_828 == * left end position: ** 21934 * transcription direction: ** POSITIVE * right end position: ** 27885 * centisome position: ** 76.7916...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-GUANIDO-BUTYRAMIDE 4-GUANIDO-BUTYRAMIDE] ==
+
== Gene Tiso_gene_828 ==
−
* smiles:
+
* left end position:
−
** C(NC(N)=[N+])CCC(=O)N
+
** 21934
−
* inchi key:
+
* transcription direction:
−
** InChIKey=YHVFECVVGNXFKO-UHFFFAOYSA-O
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 4-guanidinobutyramide
+
** 27885
−
* molecular weight:
+
* centisome position:
−
** 145.184    
+
** 76.79166    
 
* Synonym(s):
 
* Synonym(s):
−
** 4-guanidinobutanamide
 
−
** 4-guanidobutanamide
 
−
** 4-guanido-butyramide
 
−
** γ-guanidinobutyramide
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[GUANIDINOBUTANAMIDE-NH3-RXN]]
+
* [[5.99.1.3-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** in-silico_annotation
−
* [[ARGININE-2-MONOOXYGENASE-RXN]]
+
***ec-number
−
== Reaction(s) of unknown directionality ==
+
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=21934}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243936 25243936]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=27885}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58365 58365]
+
{{#set: centisome position=76.79166   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=5.99.1.3-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03078 C03078]
+
−
{{#set: smiles=C(NC(N)=[N+])CCC(=O)N}}
+
−
{{#set: inchi key=InChIKey=YHVFECVVGNXFKO-UHFFFAOYSA-O}}
+
−
{{#set: common name=4-guanidinobutyramide}}
+
−
{{#set: molecular weight=145.184   }}
+
−
{{#set: common name=4-guanidinobutanamide|4-guanidobutanamide|4-guanido-butyramide|γ-guanidinobutyramide}}
+
−
{{#set: consumed by=GUANIDINOBUTANAMIDE-NH3-RXN}}
+
−
{{#set: produced by=ARGININE-2-MONOOXYGENASE-RXN}}
+

Revision as of 18:22, 18 March 2018

Gene Tiso_gene_828

  • left end position:
    • 21934
  • transcription direction:
    • POSITIVE
  • right end position:
    • 27885
  • centisome position:
    • 76.79166
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=K%2B&oldid=23794"