Difference between revisions of "Tiso gene 9264"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMP AMP] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP([O-])([O-])=O * inchi...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-735 PWY-735] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-330...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-735 PWY-735] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** jasmonic acid biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** jasmonate biosynthesis |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''15''' reactions found over '''19''' reactions in the full pathway | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* [[RXN-10695]] | * [[RXN-10695]] | ||
− | * [[ | + | ** 2 associated gene(s): |
− | * [[ | + | *** [[Tiso_gene_14183]] |
− | * [[6 | + | *** [[Tiso_gene_12275]] |
− | * [[ | + | ** 1 reconstruction source(s) associated: |
− | * [[ | + | *** [[orthology-esiliculosus]] |
− | * [[RXN- | + | * [[RXN-10696]] |
− | * [[ | + | ** 1 associated gene(s): |
− | * [[ | + | *** [[Tiso_gene_18566]] |
− | * [[ | + | ** 2 reconstruction source(s) associated: |
− | * [[RXN- | + | *** [[annotation-in-silico_annotation]] |
− | * [[ | + | *** [[orthology-esiliculosus]] |
− | * [[ | + | * [[RXN-10697]] |
− | * [[ | + | ** 3 associated gene(s): |
− | * [[ | + | *** [[Tiso_gene_16145]] |
− | * [[ | + | *** [[Tiso_gene_6885]] |
− | + | *** [[Tiso_gene_14262]] | |
− | * [[ | + | ** 1 reconstruction source(s) associated: |
− | * [[RXN- | + | *** [[orthology-esiliculosus]] |
− | * [[ | + | * [[RXN-10698]] |
− | * [[ | + | ** 6 associated gene(s): |
+ | *** [[Tiso_gene_5857]] | ||
+ | *** [[Tiso_gene_14027]] | ||
+ | *** [[Tiso_gene_18839]] | ||
+ | *** [[Tiso_gene_14262]] | ||
+ | *** [[Tiso_gene_18838]] | ||
+ | *** [[Tiso_gene_14026]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[RXN-10699]] | ||
+ | ** 5 associated gene(s): | ||
+ | *** [[Tiso_gene_3855]] | ||
+ | *** [[Tiso_gene_15327]] | ||
+ | *** [[Tiso_gene_17451]] | ||
+ | *** [[Tiso_gene_10116]] | ||
+ | *** [[Tiso_gene_3856]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | * [[RXN-10700]] | ||
+ | ** 5 associated gene(s): | ||
+ | *** [[Tiso_gene_17451]] | ||
+ | *** [[Tiso_gene_3855]] | ||
+ | *** [[Tiso_gene_3856]] | ||
+ | *** [[Tiso_gene_15327]] | ||
+ | *** [[Tiso_gene_10116]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | * [[RXN-10701]] | ||
+ | ** 5 associated gene(s): | ||
+ | *** [[Tiso_gene_3855]] | ||
+ | *** [[Tiso_gene_10116]] | ||
+ | *** [[Tiso_gene_3856]] | ||
+ | *** [[Tiso_gene_17451]] | ||
+ | *** [[Tiso_gene_15327]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | * [[RXN-10702]] | ||
+ | ** 6 associated gene(s): | ||
+ | *** [[Tiso_gene_18838]] | ||
+ | *** [[Tiso_gene_14262]] | ||
+ | *** [[Tiso_gene_18839]] | ||
+ | *** [[Tiso_gene_14027]] | ||
+ | *** [[Tiso_gene_14026]] | ||
+ | *** [[Tiso_gene_5857]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[RXN-10703]] | ||
+ | ** 6 associated gene(s): | ||
+ | *** [[Tiso_gene_18838]] | ||
+ | *** [[Tiso_gene_5857]] | ||
+ | *** [[Tiso_gene_18839]] | ||
+ | *** [[Tiso_gene_14262]] | ||
+ | *** [[Tiso_gene_14027]] | ||
+ | *** [[Tiso_gene_14026]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[RXN-10704]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[Tiso_gene_14262]] | ||
+ | *** [[Tiso_gene_16145]] | ||
+ | *** [[Tiso_gene_6885]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[RXN-10705]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[Tiso_gene_14262]] | ||
+ | *** [[Tiso_gene_16145]] | ||
+ | *** [[Tiso_gene_6885]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[RXN-10706]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_18566]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[RXN-10707]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_18566]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[RXN-10708]] | ||
+ | ** 4 associated gene(s): | ||
+ | *** [[Tiso_gene_10984]] | ||
+ | *** [[Tiso_gene_801]] | ||
+ | *** [[Tiso_gene_7477]] | ||
+ | *** [[Tiso_gene_800]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | * [[RXN-1321]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_4463]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=12-OXOPHYTODIENOATE-REDUCTASE-RXN 12-OXOPHYTODIENOATE-REDUCTASE-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=ALLENE-OXIDE-CYCLASE-RXN ALLENE-OXIDE-CYCLASE-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-745 RXN-745] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-19 RXN1F-19] | ||
== External links == | == External links == | ||
− | * | + | * ARACYC: |
− | ** [http:// | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-735 PWY-735] |
− | + | {{#set: taxonomic range=TAX-33090}} | |
− | + | {{#set: common name=jasmonic acid biosynthesis}} | |
− | + | {{#set: common name=jasmonate biosynthesis}} | |
− | + | {{#set: reaction found=15}} | |
− | + | {{#set: total reaction=19}} | |
− | + | {{#set: completion rate=79.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 19:22, 18 March 2018
Pathway PWY-735
- taxonomic range:
- common name:
- jasmonic acid biosynthesis
- Synonym(s):
- jasmonate biosynthesis
Reaction(s) found
15 reactions found over 19 reactions in the full pathway
- RXN-10695
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-10696
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN-10697
- 3 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-10698
- 6 associated gene(s):
- 3 reconstruction source(s) associated:
- RXN-10699
- 5 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN-10700
- 5 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN-10701
- 5 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN-10702
- 6 associated gene(s):
- 3 reconstruction source(s) associated:
- RXN-10703
- 6 associated gene(s):
- 3 reconstruction source(s) associated:
- RXN-10704
- 3 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-10705
- 3 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-10706
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN-10707
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN-10708
- 4 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-1321
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ARACYC: