Difference between revisions of "PWY-6945"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7224 PWY-7224] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-3...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7014 CPD-7014] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7014 CPD-7014] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9)))) |
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** chlorophyllide b |
| + | * molecular weight: | ||
| + | ** 626.95 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-7674]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-7677]] | |
| − | + | * [[RXN-13398]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == Reaction(s) | + | * [[RXN-7673]] |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658741 90658741] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58686 58686] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16541 C16541] |
| − | {{#set: | + | {{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}} |
| + | {{#set: common name=chlorophyllide b}} | ||
| + | {{#set: molecular weight=626.95 }} | ||
| + | {{#set: consumed by=RXN-7674}} | ||
| + | {{#set: produced by=RXN-7677|RXN-13398}} | ||
| + | {{#set: consumed or produced by=RXN-7673}} | ||
Revision as of 16:53, 10 January 2018
Contents
Metabolite CPD-7014
- smiles:
- C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
- common name:
- chlorophyllide b
- molecular weight:
- 626.95
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))" cannot be used as a page name in this wiki.
