Difference between revisions of "RUMP-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOBUTANOL ISOBUTANOL] == * smiles: ** CC(C)CO * inchi key: ** InChIKey=ZXEKIIBDNHEJCQ-UHFFFAOY...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2189 CPD0-2189] == * smiles: ** C(O)C(O)C([N+])C(=O)[O-] * inchi key: ** InChIKey=JBNUARFQ...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2189 CPD0-2189] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(O)C(O)C([N+])C(=O)[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=JBNUARFQOCGDRK-GBXIJSLDSA-N |
* common name: | * common name: | ||
| − | ** | + | ** 4-hydroxy-L-threonine |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 135.119 |
* Synonym(s): | * Synonym(s): | ||
| − | ** 2- | + | ** (2S,3S)-2-amino-3,4-dihydroxybutanoic acid |
| − | ** | + | ** hydroxythreonine |
| − | ** | + | ** 3-hydroxyhomoserine |
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-14125]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| + | * CAS : 21768-45-6 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49852420 49852420] |
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C06056 C06056] | ||
* CHEMSPIDER: | * CHEMSPIDER: | ||
| − | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.167988.html 167988] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60904 60904] |
| − | * | + | * BIGG : 4hthr |
| − | + | {{#set: smiles=C(O)C(O)C([N+])C(=O)[O-]}} | |
| − | + | {{#set: inchi key=InChIKey=JBNUARFQOCGDRK-GBXIJSLDSA-N}} | |
| − | {{#set: smiles= | + | {{#set: common name=4-hydroxy-L-threonine}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: molecular weight=135.119 }} |
| − | {{#set: common name= | + | {{#set: common name=(2S,3S)-2-amino-3,4-dihydroxybutanoic acid|hydroxythreonine|3-hydroxyhomoserine}} |
| − | {{#set: molecular weight= | + | {{#set: produced by=RXN-14125}} |
| − | {{#set: common name=2- | + | |
| − | {{#set: | + | |
Revision as of 18:24, 18 March 2018
Contents
Metabolite CPD0-2189
- smiles:
- C(O)C(O)C([N+])C(=O)[O-]
- inchi key:
- InChIKey=JBNUARFQOCGDRK-GBXIJSLDSA-N
- common name:
- 4-hydroxy-L-threonine
- molecular weight:
- 135.119
- Synonym(s):
- (2S,3S)-2-amino-3,4-dihydroxybutanoic acid
- hydroxythreonine
- 3-hydroxyhomoserine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C(O)C([N+])C(=O)[O-" cannot be used as a page name in this wiki.
