Difference between revisions of "Tiso gene 11594"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15526 CPD-15526] == * smiles: ** CC23(C1(C(C(=O)NC(=O)N1)(C)C(NCNC(=O)2)3)) * inchi key: **...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5144 RXN0-5144] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5144 RXN0-5144] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | * ec number: | |
| − | + | ** [http://enzyme.expasy.org/EC/2.1.1.61 EC-2.1.1.61] | |
| − | * | + | |
| − | ** | + | |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction Formula == |
| − | = | + | * With identifiers: |
| − | * [[ | + | ** 1 [[S-ADENOSYLMETHIONINE]][c] '''+''' 1 [[tRNA-Containing-5AminoMe-2-ThioUrdines]][c] '''=>''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[tRNA-Containing-5MeAminoMe-2-ThioU]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 S-adenosyl-L-methionine[c] '''+''' 1 a 5-aminomethyl-2-thiouridine in tRNA[c] '''=>''' 1 S-adenosyl-L-homocysteine[c] '''+''' 1 H+[c] '''+''' 1 a 5-methylaminomethyl-2-thiouridine in tRNA[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * [[Tiso_gene_12443]] | ||
| + | ** [[pantograph]]-[[esiliculosus]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | * | + | * LIGAND-RXN: |
| − | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00601 R00601] |
| − | * | + | * UNIPROT: |
| − | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q9PJ66 Q9PJ66] |
| − | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
| − | {{#set: | + | {{#set: ec number=EC-2.1.1.61}} |
| − | {{#set: | + | {{#set: gene associated=Tiso_gene_12443}} |
| − | {{#set: | + | {{#set: in pathway=}} |
| − | {{#set: | + | {{#set: reconstruction category=orthology}} |
| + | {{#set: reconstruction source=orthology-esiliculosus}} | ||
| + | {{#set: reconstruction tool=pantograph}} | ||
Revision as of 18:24, 18 March 2018
Contents
Reaction RXN0-5144
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 S-ADENOSYLMETHIONINE[c] + 1 tRNA-Containing-5AminoMe-2-ThioUrdines[c] => 1 ADENOSYL-HOMO-CYS[c] + 1 PROTON[c] + 1 tRNA-Containing-5MeAminoMe-2-ThioU[c]
- With common name(s):
- 1 S-adenosyl-L-methionine[c] + 1 a 5-aminomethyl-2-thiouridine in tRNA[c] => 1 S-adenosyl-L-homocysteine[c] + 1 H+[c] + 1 a 5-methylaminomethyl-2-thiouridine in tRNA[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
External links
