Difference between revisions of "GLUCOSYLCERAMIDASE-RXN"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=SAM-PWY SAM-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-330...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-KETO-3-DEOXY-D-GLUCARATE 2-KETO-3-DEOXY-D-GLUCARATE] == * smiles: ** C(C(CC(C(C([O-])=O)O)O)=...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-KETO-3-DEOXY-D-GLUCARATE 2-KETO-3-DEOXY-D-GLUCARATE] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** C(C(CC(C(C([O-])=O)O)O)=O)([O-])=O |
| − | + | * inchi key: | |
| − | * | + | ** InChIKey=QUURPCHWPQNNGL-OKKQSCSOSA-L |
| − | ** | + | |
* common name: | * common name: | ||
| − | ** | + | ** (2S,3S)-2,3-dihydroxy-5-oxohexanedioate |
| + | * molecular weight: | ||
| + | ** 190.109 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 3-deoxy-L-allo-hex-2-ulosarate |
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == Reaction(s) | + | * [[4.1.2.20-RXN]] |
| − | * | + | |
== External links == | == External links == | ||
| − | * | + | * PUBCHEM: |
| − | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245202 25245202] |
| − | + | * CHEBI: | |
| − | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58098 58098] | |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03921 C03921] |
| − | {{#set: common name= | + | {{#set: smiles=C(C(CC(C(C([O-])=O)O)O)=O)([O-])=O}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=QUURPCHWPQNNGL-OKKQSCSOSA-L}} |
| − | {{#set: | + | {{#set: common name=(2S,3S)-2,3-dihydroxy-5-oxohexanedioate}} |
| − | {{#set: | + | {{#set: molecular weight=190.109 }} |
| + | {{#set: common name=3-deoxy-L-allo-hex-2-ulosarate}} | ||
| + | {{#set: consumed or produced by=4.1.2.20-RXN}} | ||
Revision as of 15:54, 10 January 2018
Contents
Metabolite 2-KETO-3-DEOXY-D-GLUCARATE
- smiles:
- C(C(CC(C(C([O-])=O)O)O)=O)([O-])=O
- inchi key:
- InChIKey=QUURPCHWPQNNGL-OKKQSCSOSA-L
- common name:
- (2S,3S)-2,3-dihydroxy-5-oxohexanedioate
- molecular weight:
- 190.109
- Synonym(s):
- 3-deoxy-L-allo-hex-2-ulosarate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C(CC(C(C([O-])=O)O)O)=O)([O-])=O" cannot be used as a page name in this wiki.
