Difference between revisions of "MESO-DIAMINOPIMELATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19161 CPD-19161] == * smiles: ** CCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13482 RXN-13482] == * direction: ** REVERSIBLE * common name: ** ornithine carbamoyltransferase...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19161 CPD-19161] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13482 RXN-13482] ==
−
* smiles:
+
* direction:
−
** CCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=MWKSUVQQMPJTPP-DTPVMWFYSA-J
+
 
* common name:
 
* common name:
−
** (2E,7Z)-tetradecenoyl-CoA
+
** ornithine carbamoyltransferase
−
* molecular weight:
+
* ec number:
−
** 969.83   
+
** [http://enzyme.expasy.org/EC/2.1.3.3 EC-2.1.3.3]
 
* Synonym(s):
 
* Synonym(s):
−
** 14:2-Δ2,Δ7-CoA
 
−
** 2-trans,7-cis-tetradecenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-17793]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CARBAMOYL-P]][c] '''+''' 1 [[L-ORNITHINE]][c] '''<=>''' 1 [[Pi]][c] '''+''' 1 [[L-CITRULLINE]][c] '''+''' 1 [[PROTON]][c]
−
* [[RXN-17792]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 carbamoyl phosphate[c] '''+''' 1 L-ornithine[c] '''<=>''' 1 phosphate[c] '''+''' 1 L-citrulline[c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_18444]]
 +
** EXPERIMENTAL_ANNOTATION
 +
***EC-NUMBER
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: direction=REVERSIBLE}}
−
{{#set: inchi key=InChIKey=MWKSUVQQMPJTPP-DTPVMWFYSA-J}}
+
{{#set: common name=ornithine carbamoyltransferase}}
−
{{#set: common name=(2E,7Z)-tetradecenoyl-CoA}}
+
{{#set: ec number=EC-2.1.3.3}}
−
{{#set: molecular weight=969.83    }}
+
{{#set: gene associated=Tiso_gene_18444}}
−
{{#set: common name=14:2-&Delta;2,&Delta;7-CoA|2-trans,7-cis-tetradecenoyl-CoA}}
+
{{#set: in pathway=}}
−
{{#set: consumed by=RXN-17793}}
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: produced by=RXN-17792}}
+
{{#set: reconstruction source=annotation-experimental_annotation|orthology-esiliculosus}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Revision as of 18:24, 18 March 2018

Reaction RXN-13482

  • direction:
    • REVERSIBLE
  • common name:
    • ornithine carbamoyltransferase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 carbamoyl phosphate[c] + 1 L-ornithine[c] <=> 1 phosphate[c] + 1 L-citrulline[c] + 1 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=MESO-DIAMINOPIMELATE&oldid=24142"