Difference between revisions of "Tiso gene 2588"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CROTONYL-COA CROTONYL-COA] == * smiles: ** CC=CC(SCCNC(CCNC(C(C(COP(=O)([O-])OP(OCC1(OC(C(C1OP(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSINE5TRIPHOSPHO5ADENOSINE ADENOSINE5TRIPHOSPHO5ADENOSINE] == * smiles: ** C(C3(C(C(C(N2(C1...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSINE5TRIPHOSPHO5ADENOSINE ADENOSINE5TRIPHOSPHO5ADENOSINE] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])OCC6(C(C(C(N5(C4(=C(C(=NC=N4)N)N=C5)))O6)O)O) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=QCICUPZZLIQAPA-XPWFQUROSA-K |
* common name: | * common name: | ||
− | ** | + | ** 5',5'''-diadenosine triphosphate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 753.388 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** P1,P3-bis(5'-adenosyl)triphosphate |
− | ** | + | ** 5'Ap3A |
− | ** | + | ** adenosine 5'-(tetrahydrogen triphosphate), P''-5'-ester with adenosine |
− | + | ** Ap3A | |
− | ** | + | ** adenosine(5')triphospho(5')adenosine |
− | + | ||
− | + | ||
− | ** ( | + | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[BIS5-ADENOSYL-TRIPHOSPHATASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201180 25201180] |
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58529 58529] |
− | * | + | * LIGAND-CPD: |
− | {{#set: smiles= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06197 C06197] |
− | {{#set: inchi key=InChIKey= | + | * HMDB : HMDB01155 |
− | {{#set: common name= | + | {{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])OCC6(C(C(C(N5(C4(=C(C(=NC=N4)N)N=C5)))O6)O)O)}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=QCICUPZZLIQAPA-XPWFQUROSA-K}} |
− | {{#set: common name= | + | {{#set: common name=5',5'''-diadenosine triphosphate}} |
− | + | {{#set: molecular weight=753.388 }} | |
− | {{#set: consumed | + | {{#set: common name=P1,P3-bis(5'-adenosyl)triphosphate|5'Ap3A|adenosine 5'-(tetrahydrogen triphosphate), P''-5'-ester with adenosine|Ap3A|adenosine(5')triphospho(5')adenosine}} |
+ | {{#set: consumed by=BIS5-ADENOSYL-TRIPHOSPHATASE-RXN}} |
Revision as of 18:24, 18 March 2018
Contents
Metabolite ADENOSINE5TRIPHOSPHO5ADENOSINE
- smiles:
- C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])OCC6(C(C(C(N5(C4(=C(C(=NC=N4)N)N=C5)))O6)O)O)
- inchi key:
- InChIKey=QCICUPZZLIQAPA-XPWFQUROSA-K
- common name:
- 5',5-diadenosine triphosphate
- molecular weight:
- 753.388
- Synonym(s):
- P1,P3-bis(5'-adenosyl)triphosphate
- 5'Ap3A
- adenosine 5'-(tetrahydrogen triphosphate), P-5'-ester with adenosine
- Ap3A
- adenosine(5')triphospho(5')adenosine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])OCC6(C(C(C(N5(C4(=C(C(=NC=N4)N)N=C5)))O6)O)O)" cannot be used as a page name in this wiki.