Difference between revisions of "RXN-11989"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOCHORISMATE ISOCHORISMATE] == * smiles: ** C=C(C(=O)[O-])OC1(C=CC=C(C1O)C([O-])=O) * inchi ke...") |
(Created page with "Category:Gene == Gene Tiso_gene_866 == * left end position: ** 7878 * transcription direction: ** NEGATIVE * right end position: ** 10991 * centisome position: ** 28.18302...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_866 == |
| − | * | + | * left end position: |
| − | ** | + | ** 7878 |
| − | * | + | * transcription direction: |
| − | ** | + | ** NEGATIVE |
| − | * | + | * right end position: |
| − | ** | + | ** 10991 |
| − | * | + | * centisome position: |
| − | ** | + | ** 28.183022 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == | + | == Reactions associated == |
| − | * [[ | + | * [[DNA-DIRECTED-DNA-POLYMERASE-RXN]] |
| − | + | ** in-silico_annotation | |
| − | == | + | ***ec-number |
| − | + | == Pathways associated == | |
== External links == | == External links == | ||
| − | + | {{#set: left end position=7878}} | |
| − | + | {{#set: transcription direction=NEGATIVE}} | |
| − | + | {{#set: right end position=10991}} | |
| − | + | {{#set: centisome position=28.183022 }} | |
| − | + | {{#set: reaction associated=DNA-DIRECTED-DNA-POLYMERASE-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Revision as of 18:25, 18 March 2018
Gene Tiso_gene_866
- left end position:
- 7878
- transcription direction:
- NEGATIVE
- right end position:
- 10991
- centisome position:
- 28.183022
- Synonym(s):
Reactions associated
- DNA-DIRECTED-DNA-POLYMERASE-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation
