Difference between revisions of "Tiso gene 3535"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2744 CPD-2744] == * smiles: ** C1(CC[CH]([N+](C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))...")
(Created page with "Category:Gene == Gene Tiso_gene_8055 == * left end position: ** 153 * transcription direction: ** POSITIVE * right end position: ** 1118 * centisome position: ** 1.447356...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2744 CPD-2744] ==
+
== Gene Tiso_gene_8055 ==
* smiles:
+
* left end position:
** C1(CC[CH]([N+](C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3))
+
** 153
* inchi key:
+
* transcription direction:
** InChIKey=SAWAIULJDYFLPD-SOAFEQHCSA-O
+
** POSITIVE
* common name:
+
* right end position:
** nicotine-glucuronide
+
** 1118
* molecular weight:
+
* centisome position:
** 339.367    
+
** 1.447356    
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
* [[RXN66-83]]
+
** in-silico_annotation
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
** experimental_annotation
 +
***ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=153}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820524 91820524]
+
{{#set: transcription direction=POSITIVE}}
* HMDB : HMDB01272
+
{{#set: right end position=1118}}
{{#set: smiles=C1(CC[CH]([N+](C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3))}}
+
{{#set: centisome position=1.447356   }}
{{#set: inchi key=InChIKey=SAWAIULJDYFLPD-SOAFEQHCSA-O}}
+
{{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}}
{{#set: common name=nicotine-glucuronide}}
+
{{#set: molecular weight=339.367   }}
+
{{#set: produced by=RXN66-83}}
+

Revision as of 19:26, 18 March 2018

Gene Tiso_gene_8055

  • left end position:
    • 153
  • transcription direction:
    • POSITIVE
  • right end position:
    • 1118
  • centisome position:
    • 1.447356
  • Synonym(s):

Reactions associated

Pathways associated

External links