Difference between revisions of "Tiso gene 11297"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13907 CPD-13907] == * smiles: ** C2(=O)(O[CH]1(C(O)(OCC(O)1)C(O)(O)2)) * inchi key: ** InCh...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Fructose-BisPO4-Aldolase-Lysine Fructose-BisPO4-Aldolase-Lysine] == * common name: ** [fructose...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Fructose-BisPO4-Aldolase-Lysine Fructose-BisPO4-Aldolase-Lysine] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** [fructose-bisphosphate aldolase]-lysine |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-13588]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | + | {{#set: common name=[fructose-bisphosphate aldolase]-lysine}} | |
− | + | {{#set: consumed by=RXN-13588}} | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: consumed by=RXN- | + | |
− | + |
Revision as of 19:26, 18 March 2018
Contents
Metabolite Fructose-BisPO4-Aldolase-Lysine
- common name:
- [fructose-bisphosphate aldolase]-lysine
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"fructose-bisphosphate aldolase]-lysine" cannot be used as a page name in this wiki.