Difference between revisions of "PWY-6064"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_20110 == * left end position: ** 502 * transcription direction: ** POSITIVE * right end position: ** 1719 * centisome position: ** 28.66933...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13912 CPD-13912] == * smiles: ** C(C(C(O)C(C([O-])=O)(C([O-])=O)O)O)O * inchi key: ** InChI...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13912 CPD-13912] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(C(C(O)C(C([O-])=O)(C([O-])=O)O)O)O |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=CQIRJDZGDXTXKF-UHFFFAOYSA-L |
| − | * | + | * common name: |
| − | ** | + | ** 2-carboxy-L-threo-pentonate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 208.124 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 2-carboxy-L-xylonate | ||
| + | ** 2-hydroxy-2-(1,2,3-trihydroxypropyl)propanedioate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-12871]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | * [[RXN- | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657336 90657336] |
| − | {{#set: | + | {{#set: smiles=C(C(C(O)C(C([O-])=O)(C([O-])=O)O)O)O}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=CQIRJDZGDXTXKF-UHFFFAOYSA-L}} |
| − | {{#set: | + | {{#set: common name=2-carboxy-L-threo-pentonate}} |
| − | {{#set: | + | {{#set: molecular weight=208.124 }} |
| + | {{#set: common name=2-carboxy-L-xylonate|2-hydroxy-2-(1,2,3-trihydroxypropyl)propanedioate}} | ||
| + | {{#set: produced by=RXN-12871}} | ||
Revision as of 18:27, 18 March 2018
Contents
Metabolite CPD-13912
- smiles:
- C(C(C(O)C(C([O-])=O)(C([O-])=O)O)O)O
- inchi key:
- InChIKey=CQIRJDZGDXTXKF-UHFFFAOYSA-L
- common name:
- 2-carboxy-L-threo-pentonate
- molecular weight:
- 208.124
- Synonym(s):
- 2-carboxy-L-xylonate
- 2-hydroxy-2-(1,2,3-trihydroxypropyl)propanedioate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(C(C(O)C(C([O-])=O)(C([O-])=O)O)O)O" cannot be used as a page name in this wiki.
