Difference between revisions of "Tiso gene 12995"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHYLENETETRAHYDROMETHANOPTERIN METHYLENETETRAHYDROMETHANOPTERIN] == * smiles: ** CC4([CH]3(C(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16483 RXN-16483] == * direction: ** LEFT-TO-RIGHT * common name: ** iduronate-2-sulfatase * ec...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHYLENETETRAHYDROMETHANOPTERIN METHYLENETETRAHYDROMETHANOPTERIN] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16483 RXN-16483] ==
* smiles:
+
* direction:
** CC4([CH]3(C(C)N(C2(C=CC(CC(O)C(O)C(O)COC1(C(O)C(C(COP([O-])(=O)OC(C(=O)[O-])CCC(=O)[O-])O1)O))=CC=2))CN3C5(C(=O)NC(N)=NC(N4)=5)))
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=GBMIGEWJAPFSQI-CAFBYHECSA-K
+
 
* common name:
 
* common name:
** 5,10-methylene-tetrahydromethanopterin
+
** iduronate-2-sulfatase
* molecular weight:
+
* ec number:
** 785.677   
+
** [http://enzyme.expasy.org/EC/3.1.6.13 EC-3.1.6.13]
 
* Synonym(s):
 
* Synonym(s):
** N5,N10-methylene-5,6,7,8-tetrahydromethanopterin
 
** 5,10-methylene-5,6,7,8-tetrahydromethanopterin
 
** methylene-H4MPT
 
** 5,10-methylene-H4MPT
 
** N5,N10-methylenetetrahydromethanopterin
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-15635]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-17701]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[SULFATE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CPD-17714]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 4-deoxy-2-O-sulfo-β-L-erythro-hex-4-enopyranuronosyl-(1,4)-D-N-sulfoglucosamine 6-O-sulfate[c] '''+''' 1 H2O[c] '''=>''' 1 sulfate[c] '''+''' 1 H+[c] '''+''' 1 4-deoxy-β-L-erythro-hex-4-enopyranuronosyl-(1,4)-D-N-sulfoglucosamine 6-O-sulfate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_18595]]
 +
** IN-SILICO_ANNOTATION
 +
***AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-7644]], heparin degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7644 PWY-7644]
 +
** '''1''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46931094 46931094]
+
{{#set: common name=iduronate-2-sulfatase}}
* CHEBI:
+
{{#set: ec number=EC-3.1.6.13}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57818 57818]
+
{{#set: gene associated=Tiso_gene_18595}}
* LIGAND-CPD:
+
{{#set: in pathway=PWY-7644}}
** [http://www.genome.jp/dbget-bin/www_bget?C04377 C04377]
+
{{#set: reconstruction category=annotation}}
* HMDB : HMDB60401
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
{{#set: smiles=CC4([CH]3(C(C)N(C2(C=CC(CC(O)C(O)C(O)COC1(C(O)C(C(COP([O-])(=O)OC(C(=O)[O-])CCC(=O)[O-])O1)O))=CC=2))CN3C5(C(=O)NC(N)=NC(N4)=5)))}}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: inchi key=InChIKey=GBMIGEWJAPFSQI-CAFBYHECSA-K}}
+
{{#set: common name=5,10-methylene-tetrahydromethanopterin}}
+
{{#set: molecular weight=785.677    }}
+
{{#set: common name=N5,N10-methylene-5,6,7,8-tetrahydromethanopterin|5,10-methylene-5,6,7,8-tetrahydromethanopterin|methylene-H4MPT|5,10-methylene-H4MPT|N5,N10-methylenetetrahydromethanopterin}}
+
{{#set: consumed by=RXN-15635}}
+

Revision as of 18:27, 18 March 2018

Reaction RXN-16483

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • iduronate-2-sulfatase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 4-deoxy-2-O-sulfo-β-L-erythro-hex-4-enopyranuronosyl-(1,4)-D-N-sulfoglucosamine 6-O-sulfate[c] + 1 H2O[c] => 1 sulfate[c] + 1 H+[c] + 1 4-deoxy-β-L-erythro-hex-4-enopyranuronosyl-(1,4)-D-N-sulfoglucosamine 6-O-sulfate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7644, heparin degradation: PWY-7644
    • 1 reactions found over 5 reactions in the full pathway

Reconstruction information

External links