Difference between revisions of "Tiso gene 4032"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-P-PANTOTHENATE 4-P-PANTOTHENATE] == * smiles: ** CC(C(C(=O)NCCC(=O)[O-])O)(COP([O-])([O-])=O)...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6559 PWY-6559] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-P-PANTOTHENATE 4-P-PANTOTHENATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6559 PWY-6559] ==
* smiles:
+
* taxonomic range:
** CC(C(C(=O)NCCC(=O)[O-])O)(COP([O-])([O-])=O)C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=XHFVGHPGDLDEQO-ZETCQYMHSA-K
+
 
* common name:
 
* common name:
** (R)-4'-phosphopantothenate
+
** spermidine biosynthesis II
* molecular weight:
+
** 296.193   
+
 
* Synonym(s):
 
* Synonym(s):
** 4'-phosphopantothenate
 
** 4'-P-Pantothenate
 
** D-4'-phosphopantothenate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[P-PANTOCYSLIG-RXN]]
+
'''2''' reactions found over '''4''' reactions in the full pathway
* [[RXN66-555]]
+
* [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]]
== Reaction(s) known to produce the compound ==
+
** 1 associated gene(s):
* [[PANTOTHENATE-KIN-RXN]]
+
*** [[Tiso_gene_18603]]
== Reaction(s) of unknown directionality ==
+
** 7 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
* [[ASPARTATEKIN-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Tiso_gene_17057]]
 +
*** [[Tiso_gene_13809]]
 +
*** [[Tiso_gene_16097]]
 +
*** [[Tiso_gene_4345]]
 +
** 7 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11564 RXN-11564]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11566 RXN-11566]
 
== External links  ==
 
== External links  ==
* BIGG : 4ppan
+
{{#set: taxonomic range=TAX-2}}
* PUBCHEM:
+
{{#set: common name=spermidine biosynthesis II}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16755653 16755653]
+
{{#set: reaction found=2}}
* HMDB : HMDB01016
+
{{#set: total reaction=4}}
* LIGAND-CPD:
+
{{#set: completion rate=50.0}}
** [http://www.genome.jp/dbget-bin/www_bget?C03492 C03492]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=10986 10986]
+
* METABOLIGHTS : MTBLC10986
+
{{#set: smiles=CC(C(C(=O)NCCC(=O)[O-])O)(COP([O-])([O-])=O)C}}
+
{{#set: inchi key=InChIKey=XHFVGHPGDLDEQO-ZETCQYMHSA-K}}
+
{{#set: common name=(R)-4'-phosphopantothenate}}
+
{{#set: molecular weight=296.193    }}
+
{{#set: common name=4'-phosphopantothenate|4'-P-Pantothenate|D-4'-phosphopantothenate}}
+
{{#set: consumed by=P-PANTOCYSLIG-RXN|RXN66-555}}
+
{{#set: produced by=PANTOTHENATE-KIN-RXN}}
+

Revision as of 18:28, 18 March 2018

Pathway PWY-6559

  • taxonomic range:
  • common name:
    • spermidine biosynthesis II
  • Synonym(s):

Reaction(s) found

2 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links