Difference between revisions of "Tiso gene 8531"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-delta5-lignoceroyl-ACPs cis-delta5-lignoceroyl-ACPs] == * common name: ** a cis-delta5-C24:...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11411 CPD-11411] == * smiles: ** C(OC1(C(O)C(O)C(O)C(C(=O)[O-])O1))(=O)CC2(=CC(I)=C(C(I)=C2...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11411 CPD-11411] == |
+ | * smiles: | ||
+ | ** C(OC1(C(O)C(O)C(O)C(C(=O)[O-])O1))(=O)CC2(=CC(I)=C(C(I)=C2)OC3(C=C(I)C(O)=C(I)C=3)) | ||
+ | * inchi key: | ||
+ | ** InChIKey=XZMJVZBEXSKSSM-KFYUBCHVSA-M | ||
* common name: | * common name: | ||
− | ** | + | ** tetraiodothyroacetate ester glucuronide |
+ | * molecular weight: | ||
+ | ** 922.95 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** tetraiodothyroacetic acid ester glucuronide | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-10617]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657880 90657880] |
− | {{#set: produced by= | + | {{#set: smiles=C(OC1(C(O)C(O)C(O)C(C(=O)[O-])O1))(=O)CC2(=CC(I)=C(C(I)=C2)OC3(C=C(I)C(O)=C(I)C=3))}} |
+ | {{#set: inchi key=InChIKey=XZMJVZBEXSKSSM-KFYUBCHVSA-M}} | ||
+ | {{#set: common name=tetraiodothyroacetate ester glucuronide}} | ||
+ | {{#set: molecular weight=922.95 }} | ||
+ | {{#set: common name=tetraiodothyroacetic acid ester glucuronide}} | ||
+ | {{#set: produced by=RXN-10617}} |
Revision as of 18:29, 18 March 2018
Contents
Metabolite CPD-11411
- smiles:
- C(OC1(C(O)C(O)C(O)C(C(=O)[O-])O1))(=O)CC2(=CC(I)=C(C(I)=C2)OC3(C=C(I)C(O)=C(I)C=3))
- inchi key:
- InChIKey=XZMJVZBEXSKSSM-KFYUBCHVSA-M
- common name:
- tetraiodothyroacetate ester glucuronide
- molecular weight:
- 922.95
- Synonym(s):
- tetraiodothyroacetic acid ester glucuronide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(OC1(C(O)C(O)C(O)C(C(=O)[O-])O1))(=O)CC2(=CC(I)=C(C(I)=C2)OC3(C=C(I)C(O)=C(I)C=3))" cannot be used as a page name in this wiki.