Difference between revisions of "ATPPHOSPHORIBOSYLTRANS-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-474 CPD-474] == * smiles: ** C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3))) * i...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4722 PWY-4722] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4722 PWY-4722] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** creatinine degradation II |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''1''' reactions found over '''5''' reactions in the full pathway |
− | * [[ | + | * [[SARCOSINE-DEHYDROGENASE-RXN]] |
− | + | ** 1 associated gene(s): | |
− | * [[ | + | *** [[Tiso_gene_14788]] |
− | == Reaction(s) | + | ** 1 reconstruction source(s) associated: |
+ | *** [[annotation-in-silico_annotation]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=3.5.2.14-RXN 3.5.2.14-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=CREATININE-DEAMINASE-RXN CREATININE-DEAMINASE-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=N-CARBAMOYLSARCOSINE-AMIDASE-RXN N-CARBAMOYLSARCOSINE-AMIDASE-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=SARCOX-RXN SARCOX-RXN] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=creatinine degradation II}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=5}} | |
− | + | {{#set: completion rate=20.0}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 18:29, 18 March 2018
Pathway PWY-4722
- taxonomic range:
- common name:
- creatinine degradation II
- Synonym(s):
Reaction(s) found
1 reactions found over 5 reactions in the full pathway
- SARCOSINE-DEHYDROGENASE-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated: