Difference between revisions of "RXN-8770"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-1081 RXN0-1081] == * direction: ** LEFT-TO-RIGHT * common name: ** trna-specific_adenosinedeam...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16458 CPD-16458] == * smiles: ** C2(=O)(C1(=C(NCC=N1)NC(=O)N2)) * inchi key: ** InChIKey=MY...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-1081 RXN0-1081] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16458 CPD-16458] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C2(=O)(C1(=C(NCC=N1)NC(=O)N2))
 +
* inchi key:
 +
** InChIKey=MYJNEEHZESREMO-UHFFFAOYSA-N
 
* common name:
 
* common name:
−
** trna-specific_adenosinedeaminase
+
** 7,8-dihydrolumazine
−
** trna_specific_adenosine_deaminase
+
* molecular weight:
−
* ec number:
+
** 166.139   
−
** [http://enzyme.expasy.org/EC/3.5.4 EC-3.5.4]
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[PROTON]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[tRNA-Arg-adenosine34]][c] '''=>''' 1 [[AMMONIUM]][c] '''+''' 1 [[tRNA-Arg-inosine34]][c]
+
* [[RXN-15261]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H+[c] '''+''' 1 H2O[c] '''+''' 1 an adenosine34 in [tRNAArg2][c] '''=>''' 1 ammonium[c] '''+''' 1 an inosine34 in [tRNAArg2][c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_6521]]
+
−
** IN-SILICO_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[Tiso_gene_7736]]
+
−
** IN-SILICO_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=trna-specific_adenosinedeaminase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=590555 590555]
−
{{#set: common name=trna_specific_adenosine_deaminase}}
+
{{#set: smiles=C2(=O)(C1(=C(NCC=N1)NC(=O)N2))}}
−
{{#set: ec number=EC-3.5.4}}
+
{{#set: inchi key=InChIKey=MYJNEEHZESREMO-UHFFFAOYSA-N}}
−
{{#set: gene associated=Tiso_gene_6521|Tiso_gene_7736}}
+
{{#set: common name=7,8-dihydrolumazine}}
−
{{#set: in pathway=}}
+
{{#set: molecular weight=166.139    }}
−
{{#set: reconstruction category=annotation}}
+
{{#set: produced by=RXN-15261}}
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=in-silico_annotation}}
+

Revision as of 18:29, 18 March 2018

Metabolite CPD-16458

  • smiles:
    • C2(=O)(C1(=C(NCC=N1)NC(=O)N2))
  • inchi key:
    • InChIKey=MYJNEEHZESREMO-UHFFFAOYSA-N
  • common name:
    • 7,8-dihydrolumazine
  • molecular weight:
    • 166.139
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-8770&oldid=24814"