Difference between revisions of "PWY4FS-12"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-707 RXN-707] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1.3....")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2015 CPD0-2015] == * smiles: ** CC(=O)NC(CCSC)C([O-])=O * inchi key: ** InChIKey=XUYPXLNMD...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-707 RXN-707] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2015 CPD0-2015] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(=O)NC(CCSC)C([O-])=O
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/1.3.1.21 EC-1.3.1.21]
+
** InChIKey=XUYPXLNMDZIRQH-LURJTMIESA-M
 +
* common name:
 +
** Nα-acetyl-L-methionine
 +
* molecular weight:
 +
** 190.237   
 
* Synonym(s):
 
* Synonym(s):
 +
** N-acetyl-L-methionine
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[NADPH]][c] '''+''' 1 [[CPD-700]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CPD-706]][c] '''+''' 1 [[NADP]][c]
+
* [[RXN0-6948]]
−
* With common name(s):
+
* [[RXN-17893]]
−
** 1 NADPH[c] '''+''' 1 ergosta-5,7,24(28)-trien-3β-ol[c] '''+''' 1 H+[c] '''=>''' 1 24-methylenecholesterol[c] '''+''' 1 NADP+[c]
+
* [[RXN-17892]]
−
 
+
== Reaction(s) of unknown directionality ==
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_8982]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-2541]], plant sterol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2541 PWY-2541]
+
−
** '''10''' reactions found over '''36''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* DRUGBANK : DB01646
−
{{#set: ec number=EC-1.3.1.21}}
+
* PUBCHEM:
−
{{#set: gene associated=Tiso_gene_8982}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6991985 6991985]
−
{{#set: in pathway=PWY-2541}}
+
* HMDB : HMDB11745
−
{{#set: reconstruction category=orthology}}
+
* LIGAND-CPD:
−
{{#set: reconstruction tool=pantograph}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C02712 C02712]
−
{{#set: reconstruction source=esiliculosus}}
+
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.395338.html 395338]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71670 71670]
 +
{{#set: smiles=CC(=O)NC(CCSC)C([O-])=O}}
 +
{{#set: inchi key=InChIKey=XUYPXLNMDZIRQH-LURJTMIESA-M}}
 +
{{#set: common name=Nα-acetyl-L-methionine}}
 +
{{#set: molecular weight=190.237    }}
 +
{{#set: common name=N-acetyl-L-methionine}}
 +
{{#set: produced by=RXN0-6948|RXN-17893|RXN-17892}}

Revision as of 18:30, 18 March 2018

Metabolite CPD0-2015

  • smiles:
    • CC(=O)NC(CCSC)C([O-])=O
  • inchi key:
    • InChIKey=XUYPXLNMDZIRQH-LURJTMIESA-M
  • common name:
    • Nα-acetyl-L-methionine
  • molecular weight:
    • 190.237
  • Synonym(s):
    • N-acetyl-L-methionine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=O)NC(CCSC)C([O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY4FS-12&oldid=24868"