Difference between revisions of "Tiso gene 9472"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_8328 == * left end position: ** 585 * transcription direction: ** POSITIVE * right end position: ** 2849 * centisome position: ** 5.6581874...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CAFFEOYL-COA CAFFEOYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(=CC=C(O)C(=C1)...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CAFFEOYL-COA CAFFEOYL-COA] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(=CC=C(O)C(=C1)O))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-] |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=QHRGJMIMHCLHRG-ZSELIEHESA-J |
| − | * | + | * common name: |
| − | ** | + | ** trans-caffeoyl-CoA |
| − | * | + | * molecular weight: |
| − | ** | + | ** 925.647 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 3,4-dihydroxyacryloyl-CoA | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[RXN-1126]] |
| − | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266599 45266599] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57372 57372] |
| − | {{#set: | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00323 C00323] | ||
| + | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(=CC=C(O)C(=C1)O))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}} | ||
| + | {{#set: inchi key=InChIKey=QHRGJMIMHCLHRG-ZSELIEHESA-J}} | ||
| + | {{#set: common name=trans-caffeoyl-CoA}} | ||
| + | {{#set: molecular weight=925.647 }} | ||
| + | {{#set: common name=3,4-dihydroxyacryloyl-CoA}} | ||
| + | {{#set: consumed by=CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN}} | ||
| + | {{#set: produced by=RXN-1126}} | ||
Revision as of 18:30, 18 March 2018
Contents
Metabolite CAFFEOYL-COA
- smiles:
- CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(=CC=C(O)C(=C1)O))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
- inchi key:
- InChIKey=QHRGJMIMHCLHRG-ZSELIEHESA-J
- common name:
- trans-caffeoyl-CoA
- molecular weight:
- 925.647
- Synonym(s):
- 3,4-dihydroxyacryloyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(=CC=C(O)C(=C1)O))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-" cannot be used as a page name in this wiki.
