Difference between revisions of "Tiso gene 8798"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17370 CPD-17370] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCCO)COP(=O...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11398 CPD-11398] == * smiles: ** C(=O)([O-])C([N+])CC1(=CC(I)=C(C(I)=C1)OC3(C=C(I)C(OC2(OC(...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11398 CPD-11398] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(=O)([O-])C([N+])CC1(=CC(I)=C(C(I)=C1)OC3(C=C(I)C(OC2(OC(C(=O)[O-])C(O)C(O)C(O)2))=C(I)C=3)) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=RGHRJBIKIYUHEV-SGPDEFQSSA-M |
* common name: | * common name: | ||
− | ** | + | ** L-thyroxine phenolic β-D-glucuronide |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 951.992 |
* Synonym(s): | * Synonym(s): | ||
− | ** ( | + | ** L-thyroxine phenolic glucuronide |
− | ** | + | ** thyroxine glucuronide |
+ | ** beta-D-glucopyranosiduronic acid, 4-(4-(2-amino-2-carboxyethyl)-2,6-diiodophenoxy)-2,6-diiodophenyl, (S)- | ||
+ | ** T4G | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-10606]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237176 44237176] |
− | + | {{#set: smiles=C(=O)([O-])C([N+])CC1(=CC(I)=C(C(I)=C1)OC3(C=C(I)C(OC2(OC(C(=O)[O-])C(O)C(O)C(O)2))=C(I)C=3))}} | |
− | + | {{#set: inchi key=InChIKey=RGHRJBIKIYUHEV-SGPDEFQSSA-M}} | |
− | {{#set: smiles= | + | {{#set: common name=L-thyroxine phenolic β-D-glucuronide}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: molecular weight=951.992 }} |
− | {{#set: common name= | + | {{#set: common name=L-thyroxine phenolic glucuronide|thyroxine glucuronide|beta-D-glucopyranosiduronic acid, 4-(4-(2-amino-2-carboxyethyl)-2,6-diiodophenoxy)-2,6-diiodophenyl, (S)-|T4G}} |
− | {{#set: molecular weight= | + | {{#set: produced by=RXN-10606}} |
− | {{#set: common name=( | + | |
− | {{#set: produced by=RXN- | + |
Revision as of 18:30, 18 March 2018
Contents
Metabolite CPD-11398
- smiles:
- C(=O)([O-])C([N+])CC1(=CC(I)=C(C(I)=C1)OC3(C=C(I)C(OC2(OC(C(=O)[O-])C(O)C(O)C(O)2))=C(I)C=3))
- inchi key:
- InChIKey=RGHRJBIKIYUHEV-SGPDEFQSSA-M
- common name:
- L-thyroxine phenolic β-D-glucuronide
- molecular weight:
- 951.992
- Synonym(s):
- L-thyroxine phenolic glucuronide
- thyroxine glucuronide
- beta-D-glucopyranosiduronic acid, 4-(4-(2-amino-2-carboxyethyl)-2,6-diiodophenoxy)-2,6-diiodophenyl, (S)-
- T4G
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(=O)([O-])C([N+])CC1(=CC(I)=C(C(I)=C1)OC3(C=C(I)C(OC2(OC(C(=O)[O-])C(O)C(O)C(O)2))=C(I)C=3))" cannot be used as a page name in this wiki.