Difference between revisions of "5-10-METHENYL-THF-GLU-N"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-118 CPD1F-118] == * smiles: ** CC(=CC=CC=C(C=CC=C(C=CC1(=C(CCCC1(C)C)C))C)C)C=CC=C(C=CC2(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14443 CPD-14443] == * smiles: ** C1(C(O)CC(=NC1C([O-])=O)C([O-])=O) * inchi key: ** InChIKe...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14443 CPD-14443] == |
* smiles: | * smiles: | ||
− | ** | + | ** C1(C(O)CC(=NC1C([O-])=O)C([O-])=O) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=DVTPRYHENFBCII-IMJSIDKUSA-L |
* common name: | * common name: | ||
− | ** | + | ** (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 185.136 |
* Synonym(s): | * Synonym(s): | ||
+ | ** (4S)-4-hydroxy-2,3,4,5-tetrahydro-(2S)-dipicolinate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-14014]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[DIHYDRODIPICSYN-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70678847 70678847] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=67139 67139] |
− | {{#set: smiles= | + | {{#set: smiles=C1(C(O)CC(=NC1C([O-])=O)C([O-])=O)}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=DVTPRYHENFBCII-IMJSIDKUSA-L}} |
− | {{#set: common name= | + | {{#set: common name=(2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=185.136 }} |
− | {{#set: consumed by=RXN- | + | {{#set: common name=(4S)-4-hydroxy-2,3,4,5-tetrahydro-(2S)-dipicolinate}} |
− | {{#set: produced by= | + | {{#set: consumed by=RXN-14014}} |
+ | {{#set: produced by=DIHYDRODIPICSYN-RXN}} |
Revision as of 18:30, 18 March 2018
Contents
Metabolite CPD-14443
- smiles:
- C1(C(O)CC(=NC1C([O-])=O)C([O-])=O)
- inchi key:
- InChIKey=DVTPRYHENFBCII-IMJSIDKUSA-L
- common name:
- (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate
- molecular weight:
- 185.136
- Synonym(s):
- (4S)-4-hydroxy-2,3,4,5-tetrahydro-(2S)-dipicolinate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(C(O)CC(=NC1C([O-])=O)C([O-])=O)" cannot be used as a page name in this wiki.