Difference between revisions of "GALACTOSE-1P"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_428 == * Synonym(s): == Reactions associated == * GCVP-RXN ** pantograph-esiliculosus * GLYCINE-DEHYDROGENASE-RXN ** in-si...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2030 CPD0-2030] == * smiles: ** C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O * inchi key: ** In...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_428 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2030 CPD0-2030] ==
 +
* smiles:
 +
** C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O
 +
* inchi key:
 +
** InChIKey=ZWZWYGMENQVNFU-UHNVWZDZSA-M
 +
* common name:
 +
** glycerophosphoserine
 +
* molecular weight:
 +
** 258.144   
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[GCVP-RXN]]
+
* [[RXN-14136]]
** [[pantograph]]-[[esiliculosus]]
+
== Reaction(s) known to produce the compound ==
* [[GLYCINE-DEHYDROGENASE-RXN]]
+
== Reaction(s) of unknown directionality ==
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
== Pathways associated ==
+
* [[GLYCINE-SYN2-PWY]]
+
* [[GLYCLEAV-PWY]]
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=GCVP-RXN|GLYCINE-DEHYDROGENASE-RXN}}
+
* PUBCHEM:
{{#set: pathway associated=GLYCINE-SYN2-PWY|GLYCLEAV-PWY}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=57339260 57339260]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61931 61931]
 +
* BIGG : g3ps
 +
{{#set: smiles=C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O}}
 +
{{#set: inchi key=InChIKey=ZWZWYGMENQVNFU-UHNVWZDZSA-M}}
 +
{{#set: common name=glycerophosphoserine}}
 +
{{#set: molecular weight=258.144    }}
 +
{{#set: consumed by=RXN-14136}}

Revision as of 18:31, 18 March 2018

Metabolite CPD0-2030

  • smiles:
    • C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O
  • inchi key:
    • InChIKey=ZWZWYGMENQVNFU-UHNVWZDZSA-M
  • common name:
    • glycerophosphoserine
  • molecular weight:
    • 258.144
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O" cannot be used as a page name in this wiki.