Difference between revisions of "FNorh"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Nucleoside-Triphosphates Nucleoside-Triphosphates] == * common name: ** a nucleoside triphospha...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANINE GUANINE] == * smiles: ** C2(=NC1(=C(N=C(NC(=O)1)N)N2)) * inchi key: ** InChIKey=UYTPUPD...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANINE GUANINE] == |
| + | * smiles: | ||
| + | ** C2(=NC1(=C(N=C(NC(=O)1)N)N2)) | ||
| + | * inchi key: | ||
| + | ** InChIKey=UYTPUPDQBNUYGX-UHFFFAOYSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** guanine |
| + | * molecular weight: | ||
| + | ** 151.127 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** G |
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[GUANINE-DEAMINASE-RXN]] |
| − | + | ||
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN0-366]] |
| + | * [[RXN0-1321]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[GUANPRIBOSYLTRAN-RXN]] |
| + | * [[QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN]] | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * CAS : 73-40-5 |
| − | {{#set: common name= | + | * METABOLIGHTS : MTBLC16235 |
| − | {{#set: consumed by= | + | * DRUGBANK : DB02377 |
| − | {{#set: produced by= | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=764 764] |
| + | * HMDB : HMDB00132 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00242 C00242] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.744.html 744] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16235 16235] | ||
| + | * BIGG : gua | ||
| + | {{#set: smiles=C2(=NC1(=C(N=C(NC(=O)1)N)N2))}} | ||
| + | {{#set: inchi key=InChIKey=UYTPUPDQBNUYGX-UHFFFAOYSA-N}} | ||
| + | {{#set: common name=guanine}} | ||
| + | {{#set: molecular weight=151.127 }} | ||
| + | {{#set: common name=G}} | ||
| + | {{#set: consumed by=GUANINE-DEAMINASE-RXN}} | ||
| + | {{#set: produced by=RXN0-366|RXN0-1321}} | ||
| + | {{#set: reversible reaction associated=GUANPRIBOSYLTRAN-RXN|QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN}} | ||
Revision as of 18:32, 18 March 2018
Contents
Metabolite GUANINE
- smiles:
- C2(=NC1(=C(N=C(NC(=O)1)N)N2))
- inchi key:
- InChIKey=UYTPUPDQBNUYGX-UHFFFAOYSA-N
- common name:
- guanine
- molecular weight:
- 151.127
- Synonym(s):
- G
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 73-40-5
- METABOLIGHTS : MTBLC16235
- DRUGBANK : DB02377
- PUBCHEM:
- HMDB : HMDB00132
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : gua
