Difference between revisions of "3.1.22.4-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Non-Glucur-Glucuronoside-Acceptors Non-Glucur-Glucuronoside-Acceptors] == * common name: ** a n...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTAPRENYL-METHYL-METHOXY-BENZQ OCTAPRENYL-METHYL-METHOXY-BENZQ] == * smiles: ** CC(=CCCC(=CCCC...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTAPRENYL-METHYL-METHOXY-BENZQ OCTAPRENYL-METHYL-METHOXY-BENZQ] == |
+ | * smiles: | ||
+ | ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(=C1C)O)O))C)C)C)C)C)C)C)C | ||
+ | * inchi key: | ||
+ | ** InChIKey=HDSGDGSLNMIMKU-KFSSTAEESA-N | ||
* common name: | * common name: | ||
− | ** | + | ** 6-methoxy-3-methyl-2-all-trans-octaprenyl-1,4-benzoquinol |
+ | * molecular weight: | ||
+ | ** 699.111 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 2-octaprenyl-3-methyl-6-methoxy-1,4-benzenediol | ||
+ | ** 6-methoxy-3-methyl-2-octaprenylquinol | ||
+ | ** 2-octaprenyl-3-methyl-6-methoxyhydroquinone | ||
+ | ** 2-octaprenyl-3-methyl-6-methoxyquinol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[2-OCTAPRENYL-METHOXY-BENZOQ-METH-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49852330 49852330] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60656 60656] | ||
+ | * BIGG : 2ommbl | ||
+ | {{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(=C1C)O)O))C)C)C)C)C)C)C)C}} | ||
+ | {{#set: inchi key=InChIKey=HDSGDGSLNMIMKU-KFSSTAEESA-N}} | ||
+ | {{#set: common name=6-methoxy-3-methyl-2-all-trans-octaprenyl-1,4-benzoquinol}} | ||
+ | {{#set: molecular weight=699.111 }} | ||
+ | {{#set: common name=2-octaprenyl-3-methyl-6-methoxy-1,4-benzenediol|6-methoxy-3-methyl-2-octaprenylquinol|2-octaprenyl-3-methyl-6-methoxyhydroquinone|2-octaprenyl-3-methyl-6-methoxyquinol}} | ||
+ | {{#set: produced by=2-OCTAPRENYL-METHOXY-BENZOQ-METH-RXN}} |
Revision as of 18:32, 18 March 2018
Contents
Metabolite OCTAPRENYL-METHYL-METHOXY-BENZQ
- smiles:
- CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(=C1C)O)O))C)C)C)C)C)C)C)C
- inchi key:
- InChIKey=HDSGDGSLNMIMKU-KFSSTAEESA-N
- common name:
- 6-methoxy-3-methyl-2-all-trans-octaprenyl-1,4-benzoquinol
- molecular weight:
- 699.111
- Synonym(s):
- 2-octaprenyl-3-methyl-6-methoxy-1,4-benzenediol
- 6-methoxy-3-methyl-2-octaprenylquinol
- 2-octaprenyl-3-methyl-6-methoxyhydroquinone
- 2-octaprenyl-3-methyl-6-methoxyquinol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links