Difference between revisions of "Tiso gene 10268"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CIT CIT] == * smiles: ** C(=O)([O-])CC(C(=O)[O-])(O)CC(=O)[O-] * inchi key: ** InChIKey=KRKNYBC...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9247 CPD-9247] == * smiles: ** CCCCCCC=CCCCCCCCCCC(=O)[O-] * inchi key: ** InChIKey=UWHZIFQ...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9247 CPD-9247] == |
* smiles: | * smiles: | ||
− | ** | + | ** CCCCCCC=CCCCCCCCCCC(=O)[O-] |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=UWHZIFQPPBDJPM-FPLPWBNLSA-M |
* common name: | * common name: | ||
− | ** | + | ** cis-vaccenate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 281.457 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** cis-vaccenic acid |
− | ** | + | ** (Z)-octadec-11-enoate |
− | ** | + | ** (Z)-11-octadecenoic acid |
− | ** | + | ** cis-11-octadecenoic acid |
+ | ** cis-octadec-11-enoic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN0-7238]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
− | |||
− | |||
== External links == | == External links == | ||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5461069 5461069] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* CHEMSPIDER: | * CHEMSPIDER: | ||
− | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.4574428.html 4574428] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30827 30827] |
− | + | {{#set: smiles=CCCCCCC=CCCCCCCCCCC(=O)[O-]}} | |
− | {{#set: smiles= | + | {{#set: inchi key=InChIKey=UWHZIFQPPBDJPM-FPLPWBNLSA-M}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: common name=cis-vaccenate}} |
− | {{#set: common name= | + | {{#set: molecular weight=281.457 }} |
− | {{#set: molecular weight= | + | {{#set: common name=cis-vaccenic acid|(Z)-octadec-11-enoate|(Z)-11-octadecenoic acid|cis-11-octadecenoic acid|cis-octadec-11-enoic acid}} |
− | {{#set: common name= | + | {{#set: consumed by=RXN0-7238}} |
− | + | ||
− | {{#set: consumed | + |
Revision as of 18:32, 18 March 2018
Contents
Metabolite CPD-9247
- smiles:
- CCCCCCC=CCCCCCCCCCC(=O)[O-]
- inchi key:
- InChIKey=UWHZIFQPPBDJPM-FPLPWBNLSA-M
- common name:
- cis-vaccenate
- molecular weight:
- 281.457
- Synonym(s):
- cis-vaccenic acid
- (Z)-octadec-11-enoate
- (Z)-11-octadecenoic acid
- cis-11-octadecenoic acid
- cis-octadec-11-enoic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCC=CCCCCCCCCCC(=O)[O-" cannot be used as a page name in this wiki.