Difference between revisions of "GTHP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=endothelin-1 endothelin-1] == * common name: ** endothelin 1 * Synonym(s): == Reaction(s) know...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19488 CPD-19488] == * smiles: ** CSCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-] * inchi key: ** InChIKe...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19488 CPD-19488] == |
| + | * smiles: | ||
| + | ** CSCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-] | ||
| + | * inchi key: | ||
| + | ** InChIKey=PBYOKOGRHHZTHQ-UHFFFAOYSA-L | ||
* common name: | * common name: | ||
| − | ** | + | ** 3-isopropyl-9-(methylthio)-2-oxononanoate |
| + | * molecular weight: | ||
| + | ** 260.304 | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-18203]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-18202]] | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | {{#set: smiles=CSCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-]}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=PBYOKOGRHHZTHQ-UHFFFAOYSA-L}} |
| + | {{#set: common name=3-isopropyl-9-(methylthio)-2-oxononanoate}} | ||
| + | {{#set: molecular weight=260.304 }} | ||
| + | {{#set: consumed by=RXN-18203}} | ||
| + | {{#set: reversible reaction associated=RXN-18202}} | ||
Revision as of 18:32, 18 March 2018
Contents
Metabolite CPD-19488
- smiles:
- CSCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-]
- inchi key:
- InChIKey=PBYOKOGRHHZTHQ-UHFFFAOYSA-L
- common name:
- 3-isopropyl-9-(methylthio)-2-oxononanoate
- molecular weight:
- 260.304
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CSCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-" cannot be used as a page name in this wiki.
