Difference between revisions of "Tiso gene 15885"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16020 RXN-16020] == * direction: ** LEFT-TO-RIGHT * common name: ** chloroplast_beta-keto_acyl_...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1081 CPD0-1081] == * smiles: ** CC(C(=O)[O-])OC2(C(NC(=O)C)C1(OCC(O1)C2OC3(OC(CO)C(O)C(O)C...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16020 RXN-16020] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1081 CPD0-1081] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C(=O)[O-])OC2(C(NC(=O)C)C1(OCC(O1)C2OC3(OC(CO)C(O)C(O)C(NC(C)=O)3)))
 +
* inchi key:
 +
** InChIKey=MWWQKONGFKUAEK-NNRGKNABSA-M
 
* common name:
 
* common name:
−
** chloroplast_beta-keto_acyl_reductase
+
** N-acetyl-β-D-glucosamine(anhydrous)-N-acetylmuramate
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.1.1.330 EC-1.1.1.330]
+
** 477.444   
 
* Synonym(s):
 
* Synonym(s):
 +
** glcNAc-1,6-anhMurNAc
 +
** N-acetyl-β-D-glucosamine(anhydrous)-N-acetylmuramic acid
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN0-5226]]
−
** 1 [[NADH-P-OR-NOP]][c] '''+''' 1 [[CPD-17262]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[NAD-P-OR-NOP]][c] '''+''' 1 [[CPD-17263]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 NAD(P)H[c] '''+''' 1 3-oxo-icosatetraenoyl-CoA[c] '''+''' 1 H+[c] '''=>''' 1 NAD(P)+[c] '''+''' 1 (8Z,11Z,14Z,17Z)-3-hydroxy-icosa-8,11,14,17-tetraenoyl-CoA[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_9871]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
** EXPERIMENTAL_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-7049]], icosapentaenoate biosynthesis II (6-desaturase, mammals): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7049 PWY-7049]
+
−
** '''2''' reactions found over '''7''' reactions in the full pathway
+
−
* [[PWY-6958]], icosapentaenoate biosynthesis I (lower eukaryotes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6958 PWY-6958]
+
−
** '''2''' reactions found over '''8''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[experimental_annotation]]
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=chloroplast_beta-keto_acyl_reductase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658409 90658409]
−
{{#set: ec number=EC-1.1.1.330}}
+
* BIGG : anhgm
−
{{#set: gene associated=Tiso_gene_9871}}
+
{{#set: smiles=CC(C(=O)[O-])OC2(C(NC(=O)C)C1(OCC(O1)C2OC3(OC(CO)C(O)C(O)C(NC(C)=O)3)))}}
−
{{#set: in pathway=PWY-7049|PWY-6958}}
+
{{#set: inchi key=InChIKey=MWWQKONGFKUAEK-NNRGKNABSA-M}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: common name=N-acetyl-β-D-glucosamine(anhydrous)-N-acetylmuramate}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: molecular weight=477.444    }}
−
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
+
{{#set: common name=glcNAc-1,6-anhMurNAc|N-acetyl-β-D-glucosamine(anhydrous)-N-acetylmuramic acid}}
 +
{{#set: consumed by=RXN0-5226}}

Revision as of 18:32, 18 March 2018

Metabolite CPD0-1081

  • smiles:
    • CC(C(=O)[O-])OC2(C(NC(=O)C)C1(OCC(O1)C2OC3(OC(CO)C(O)C(O)C(NC(C)=O)3)))
  • inchi key:
    • InChIKey=MWWQKONGFKUAEK-NNRGKNABSA-M
  • common name:
    • N-acetyl-β-D-glucosamine(anhydrous)-N-acetylmuramate
  • molecular weight:
    • 477.444
  • Synonym(s):
    • glcNAc-1,6-anhMurNAc
    • N-acetyl-β-D-glucosamine(anhydrous)-N-acetylmuramic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C(=O)[O-])OC2(C(NC(=O)C)C1(OCC(O1)C2OC3(OC(CO)C(O)C(O)C(NC(C)=O)3)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_15885&oldid=25166"