Difference between revisions of "Tiso gene 8"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORYL-ETHANOLAMINE PHOSPHORYL-ETHANOLAMINE] == * smiles: ** C(C[N+])OP([O-])([O-])=O * inc...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-9-O-ACETYLNEURAMINATE N-ACETYL-9-O-ACETYLNEURAMINATE] == * smiles: ** CC(NC1(C(CC(O)(C...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-9-O-ACETYLNEURAMINATE N-ACETYL-9-O-ACETYLNEURAMINATE] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(NC1(C(CC(O)(C(=O)[O-])OC1C(C(COC(=O)C)O)O)O))=O |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=NYWZBRWKDRMPAS-GYQVTDHRSA-M |
* common name: | * common name: | ||
− | ** O- | + | ** N-acetyl-9-O-acetylneuraminate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 350.302 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-13182]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244648 25244648] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28999 28999] |
− | * | + | * LIGAND-CPD: |
− | {{#set: smiles=C(C | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04017 C04017] |
− | {{#set: inchi key=InChIKey= | + | {{#set: smiles=CC(NC1(C(CC(O)(C(=O)[O-])OC1C(C(COC(=O)C)O)O)O))=O}} |
− | {{#set: common name=O- | + | {{#set: inchi key=InChIKey=NYWZBRWKDRMPAS-GYQVTDHRSA-M}} |
− | {{#set: molecular weight= | + | {{#set: common name=N-acetyl-9-O-acetylneuraminate}} |
− | + | {{#set: molecular weight=350.302 }} | |
− | {{#set: consumed by= | + | {{#set: consumed by=RXN-13182}} |
− | + | ||
− | + |
Revision as of 18:33, 18 March 2018
Contents
Metabolite N-ACETYL-9-O-ACETYLNEURAMINATE
- smiles:
- CC(NC1(C(CC(O)(C(=O)[O-])OC1C(C(COC(=O)C)O)O)O))=O
- inchi key:
- InChIKey=NYWZBRWKDRMPAS-GYQVTDHRSA-M
- common name:
- N-acetyl-9-O-acetylneuraminate
- molecular weight:
- 350.302
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(NC1(C(CC(O)(C(=O)[O-])OC1C(C(COC(=O)C)O)O)O))=O" cannot be used as a page name in this wiki.