Difference between revisions of "Amino-Acids-20"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDP CDP] == * smiles: ** C(C2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))OP(OP([O-])([O-])=O)([O-])=O *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-431 CPD-431] == * smiles: ** C1(C=C(O)C=CC=1C3(=CC(=O)C2(=C(C=C([O-])C=C(O)2)O3))) * inchi...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-431 CPD-431] == |
* smiles: | * smiles: | ||
− | ** | + | ** C1(C=C(O)C=CC=1C3(=CC(=O)C2(=C(C=C([O-])C=C(O)2)O3))) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=KZNIFHPLKGYRTM-UHFFFAOYSA-M |
* common name: | * common name: | ||
− | ** | + | ** apigenin |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 269.233 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 4',5,7-trihydroxyflavone |
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-7651]] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | * CAS : | + | * CAS : 520-36-5 |
− | * | + | * LIPID_MAPS : LMPK12110005 |
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200950 25200950] |
− | * HMDB : | + | * HMDB : HMDB02124 |
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01477 C01477] |
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58470 58470] |
− | + | {{#set: smiles=C1(C=C(O)C=CC=1C3(=CC(=O)C2(=C(C=C([O-])C=C(O)2)O3)))}} | |
− | {{#set: smiles= | + | {{#set: inchi key=InChIKey=KZNIFHPLKGYRTM-UHFFFAOYSA-M}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: common name=apigenin}} |
− | {{#set: common name= | + | {{#set: molecular weight=269.233 }} |
− | {{#set: molecular weight= | + | {{#set: common name=4',5,7-trihydroxyflavone}} |
− | {{#set: common name= | + | {{#set: consumed by=RXN-7651}} |
− | {{#set: consumed by= | + | |
− | + |
Revision as of 18:33, 18 March 2018
Contents
Metabolite CPD-431
- smiles:
- C1(C=C(O)C=CC=1C3(=CC(=O)C2(=C(C=C([O-])C=C(O)2)O3)))
- inchi key:
- InChIKey=KZNIFHPLKGYRTM-UHFFFAOYSA-M
- common name:
- apigenin
- molecular weight:
- 269.233
- Synonym(s):
- 4',5,7-trihydroxyflavone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 520-36-5
- LIPID_MAPS : LMPK12110005
- PUBCHEM:
- HMDB : HMDB02124
- LIGAND-CPD:
- CHEBI:
"C1(C=C(O)C=CC=1C3(=CC(=O)C2(=C(C=C([O-])C=C(O)2)O3)))" cannot be used as a page name in this wiki.