Difference between revisions of "CPD-18379"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18550 CPD-18550] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=LARABITOLUTIL-PWY LARABITOLUTIL-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?obje...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18550 CPD-18550] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=LARABITOLUTIL-PWY LARABITOLUTIL-PWY] ==
−
* smiles:
+
* taxonomic range:
−
** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(C=NC5(=CC=CC=C(N=4)5)))([O-])=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-7742 TAX-7742]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
−
** InChIKey=VMJWEICPCDRXQL-SCFUHWHPSA-M
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224]
 
* common name:
 
* common name:
−
** quinoxaline-2-carboxyl adenylate
+
** xylitol degradation
−
* molecular weight:
+
−
** 502.359   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** L-arabitol and xylitol utilization
 +
** L-arabitol and xylitol degradation
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-17155]]
+
* '''1''' reaction(s) found
−
== Reaction(s) known to produce the compound ==
+
** [[XYLULOKIN-RXN]]
−
== Reaction(s) of unknown directionality ==
+
== Reaction(s) not found ==
 +
* '''1''' reaction(s) not found
 +
** [http://metacyc.org/META/NEW-IMAGE?object=D-XYLULOSE-REDUCTASE-RXN D-XYLULOSE-REDUCTASE-RXN]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-7742}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102515331 102515331]
+
{{#set: taxonomic range=TAX-4751}}
−
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(C=NC5(=CC=CC=C(N=4)5)))([O-])=O}}
+
{{#set: taxonomic range=TAX-1224}}
−
{{#set: inchi key=InChIKey=VMJWEICPCDRXQL-SCFUHWHPSA-M}}
+
{{#set: common name=xylitol degradation}}
−
{{#set: common name=quinoxaline-2-carboxyl adenylate}}
+
{{#set: common name=L-arabitol and xylitol utilization|L-arabitol and xylitol degradation}}
−
{{#set: molecular weight=502.359    }}
+
{{#set: reaction found=1}}
−
{{#set: consumed by=RXN-17155}}
+
{{#set: reaction not found=1}}

Revision as of 15:56, 10 January 2018

Pathway LARABITOLUTIL-PWY

  • taxonomic range:
  • common name:
    • xylitol degradation
  • Synonym(s):
    • L-arabitol and xylitol utilization
    • L-arabitol and xylitol degradation

Reaction(s) found

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-18379&oldid=10943"