Difference between revisions of "HYDROGEN-MOLECULE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5662 CPD-5662] == * smiles: ** C(S)C1(C(NC(N1)=O)CCCCCC(=O)[O-]) * inchi key: ** InChIKey=Z...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Red-NADPH-Hemoprotein-Reductases Red-NADPH-Hemoprotein-Reductases] == * common name: ** a reduc...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Red-NADPH-Hemoprotein-Reductases Red-NADPH-Hemoprotein-Reductases] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a reduced [NADPH-hemoprotein reductase] |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN66-181]] |
| + | * [[HEME-OXYGENASE-DECYCLIZING-RXN]] | ||
| + | * [[RXN66-161]] | ||
| + | * [[RXN-8630]] | ||
| + | * [[RXN-11057]] | ||
| + | * [[RXN-11056]] | ||
| + | * [[RXN66-169]] | ||
| + | * [[RXN66-146]] | ||
| + | * [[RXN66-163]] | ||
| + | * [[UNSPECIFIC-MONOOXYGENASE-RXN]] | ||
| + | * [[RXN-13064]] | ||
| + | * [[RXN-8872]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a reduced [NADPH-hemoprotein reductase]}} | |
| − | + | {{#set: consumed by=RXN66-181|HEME-OXYGENASE-DECYCLIZING-RXN|RXN66-161|RXN-8630|RXN-11057|RXN-11056|RXN66-169|RXN66-146|RXN66-163|UNSPECIFIC-MONOOXYGENASE-RXN|RXN-13064|RXN-8872}} | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
Revision as of 18:33, 18 March 2018
Contents
Metabolite Red-NADPH-Hemoprotein-Reductases
- common name:
- a reduced [NADPH-hemoprotein reductase]
- Synonym(s):
Reaction(s) known to consume the compound
- RXN66-181
- HEME-OXYGENASE-DECYCLIZING-RXN
- RXN66-161
- RXN-8630
- RXN-11057
- RXN-11056
- RXN66-169
- RXN66-146
- RXN66-163
- UNSPECIFIC-MONOOXYGENASE-RXN
- RXN-13064
- RXN-8872
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a reduced [NADPH-hemoprotein reductase" cannot be used as a page name in this wiki.
