Difference between revisions of "CPD-10586"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYCYTIDINE DEOXYCYTIDINE] == * smiles: ** C1(=CN(C(=O)N=C(N)1)C2(CC(O)C(CO)O2)) * inchi key:...") |
(Created page with "Category:Gene == Gene Tiso_gene_7378 == * Synonym(s): == Reactions associated == * RXN-982 ** pantograph-esiliculosus == Pathways associated == * PWY-4621...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_7378 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[RXN-982]] |
− | + | ** [[pantograph]]-[[esiliculosus]] | |
− | == | + | == Pathways associated == |
+ | * [[PWY-4621]] | ||
+ | * [[PWY-4202]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=RXN-982}} | |
− | + | {{#set: pathway associated=PWY-4621|PWY-4202}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Revision as of 19:34, 18 March 2018
Gene Tiso_gene_7378
- Synonym(s):