Difference between revisions of "RXNQT-4171"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_8862 == * Synonym(s): == Reactions associated == * LPLPS1AGPE180 ** pantograph-creinhardtii == Pathways associated == == Exter...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4101 CPD-4101] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_8862 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4101 CPD-4101] ==
 +
* smiles:
 +
** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34))))
 +
* inchi key:
 +
** InChIKey=RSMKYRDCCSNYFM-AAGDOFLISA-N
 +
* common name:
 +
** 24-methylenelophenol
 +
* molecular weight:
 +
** 412.698   
 
* Synonym(s):
 
* Synonym(s):
 +
** 4α-methyl-5α-ergosta-7,24-dien-3β-ol
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[LPLPS1AGPE180]]
+
* [[2.1.1.143-RXN]]
** [[pantograph]]-[[creinhardtii]]
+
== Reaction(s) known to produce the compound ==
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=LPLPS1AGPE180}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5283640 5283640]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29107 29107]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C11522 C11522]
 +
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: inchi key=InChIKey=RSMKYRDCCSNYFM-AAGDOFLISA-N}}
 +
{{#set: common name=24-methylenelophenol}}
 +
{{#set: molecular weight=412.698    }}
 +
{{#set: common name=4α-methyl-5α-ergosta-7,24-dien-3β-ol}}
 +
{{#set: consumed by=2.1.1.143-RXN}}

Revision as of 19:34, 18 March 2018

Metabolite CPD-4101

  • smiles:
    • CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=RSMKYRDCCSNYFM-AAGDOFLISA-N
  • common name:
    • 24-methylenelophenol
  • molecular weight:
    • 412.698
  • Synonym(s):
    • 4α-methyl-5α-ergosta-7,24-dien-3β-ol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.