Difference between revisions of "Tiso gene 18971"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-720 CPD-720] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9534 RXN-9534] == * direction: ** LEFT-TO-RIGHT * common name: ** trans dodec-2-enoyl-[acyl-car...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-720 CPD-720] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9534 RXN-9534] ==
−
* smiles:
+
* direction:
−
** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=WPHVOXMMNSLJSF-DAWJDVIISA-N
+
 
* common name:
 
* common name:
−
** 6-deoxotyphasterol
+
** trans dodec-2-enoyl-[acyl-carrier protein] reductase (NADPH, B-specific)
−
* molecular weight:
+
** polyketide_synthase
−
** 434.701   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.3.1.10 EC-1.3.1.10]
 +
** [http://enzyme.expasy.org/EC/1.3.1.39 EC-1.3.1.39]
 +
** [http://enzyme.expasy.org/EC/2.3.1.85 EC-2.3.1.85]
 +
** [http://enzyme.expasy.org/EC/2.3.1.86 EC-2.3.1.86]
 
* Synonym(s):
 
* Synonym(s):
−
** deoxotyphasterol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-4241]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Dodec-2-enoyl-ACPs]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[Dodecanoyl-ACPs]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 NADPH[c] '''+''' 1 H+[c] '''+''' 1 a (2E)-dodec-2-enoyl-[acp][c] '''=>''' 1 NADP+[c] '''+''' 1 a dodecanoyl-[acp][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_500]]
 +
** IN-SILICO_ANNOTATION
 +
***EC-NUMBER
 +
* [[Tiso_gene_13394]]
 +
** IN-SILICO_ANNOTATION
 +
***EC-NUMBER
 +
* [[Tiso_gene_136]]
 +
** IN-SILICO_ANNOTATION
 +
***EC-NUMBER
 +
* [[Tiso_gene_10778]]
 +
** [[pantograph]]-[[synechocystis]]
 +
* [[Tiso_gene_135]]
 +
** IN-SILICO_ANNOTATION
 +
***EC-NUMBER
 +
* [[Tiso_gene_10876]]
 +
** IN-SILICO_ANNOTATION
 +
***EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-5994]], palmitate biosynthesis I (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5994 PWY-5994]
 +
** '''31''' reactions found over '''31''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-synechocystis]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[manual]]
 +
** Source: [[manual-primary_network]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16061346 16061346]
+
{{#set: common name=trans dodec-2-enoyl-[acyl-carrier protein] reductase (NADPH, B-specific)}}
−
* CHEBI:
+
{{#set: common name=polyketide_synthase}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20717 20717]
+
{{#set: ec number=EC-1.3.1.10}}
−
* LIGAND-CPD:
+
{{#set: ec number=EC-1.3.1.39}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15801 C15801]
+
{{#set: ec number=EC-2.3.1.85}}
−
{{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: ec number=EC-2.3.1.86}}
−
{{#set: inchi key=InChIKey=WPHVOXMMNSLJSF-DAWJDVIISA-N}}
+
{{#set: gene associated=Tiso_gene_500|Tiso_gene_13394|Tiso_gene_136|Tiso_gene_10778|Tiso_gene_135|Tiso_gene_10876}}
−
{{#set: common name=6-deoxotyphasterol}}
+
{{#set: in pathway=PWY-5994}}
−
{{#set: molecular weight=434.701    }}
+
{{#set: reconstruction category=orthology|manual|annotation}}
−
{{#set: common name=deoxotyphasterol}}
+
{{#set: reconstruction source=manual-primary_network|annotation-in-silico_annotation|orthology-synechocystis}}
−
{{#set: consumed by=RXN-4241}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}

Revision as of 18:34, 18 March 2018

Reaction RXN-9534

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5994, palmitate biosynthesis I (animals and fungi): PWY-5994
    • 31 reactions found over 31 reactions in the full pathway

Reconstruction information

External links

"trans dodec-2-enoyl-[acyl-carrier protein] reductase (NADPH, B-specific)" cannot be used as a page name in this wiki.






Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_18971&oldid=25390"